Difference between revisions of "Tiso gene 5424"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7418 CPD-7418] == * smiles: ** C(C=CC1(=C(C=CC=C1)O))(=O)[O-] * inchi key: ** InChIKey=PMOW...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7161 PWY-7161] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-91827 TAX-9...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7161 PWY-7161] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-91827 TAX-91827] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** polymethylated quercetin biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | * '''1''' reaction(s) found |
− | == Reaction(s) | + | ** [[QUERCETIN-3-O-METHYLTRANSFERASE-RXN]] |
− | * [[RXN- | + | == Reaction(s) not found == |
− | == | + | * '''8''' reaction(s) not found |
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-13929 RXN-13929] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-8262 RXN-8262] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-13932 RXN-13932] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-13906 RXN-13906] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-13930 RXN-13930] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-13934 RXN-13934] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=2.1.1.82-RXN 2.1.1.82-RXN] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-13933 RXN-13933] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-91827}} | |
− | + | {{#set: common name=polymethylated quercetin biosynthesis}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: reaction not found=8}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 15:52, 10 January 2018
Pathway PWY-7161
- taxonomic range:
- common name:
- polymethylated quercetin biosynthesis
- Synonym(s):
Reaction(s) found
- 1 reaction(s) found
Reaction(s) not found
- 8 reaction(s) not found