Difference between revisions of "Tiso gene 11334"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11495 CPD-11495] == * smiles: ** C(=O)([O-])CC1(=CC=CC=C(O)1) * inchi key: ** InChIKey=CCVY...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5283 PWY-5283] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11495 CPD-11495] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5283 PWY-5283] ==
−
* smiles:
+
* taxonomic range:
−
** C(=O)([O-])CC1(=CC=CC=C(O)1)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
−
** InChIKey=CCVYRRGZDBSHFU-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
−
** 2-hydroxyphenylacetate
+
** L-lysine degradation V
−
* molecular weight:
+
−
** 151.141   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2-hydroxyphenylacetic acid
+
** 2-aminoadipate pathway
−
** benzeneacetic acid, 2-hydroxy-
+
−
** 2-hydroxybenzeneacetic acid
+
−
** acetic acid, (o-hydroxyphenyl)-
+
−
** o-hydroxy phenylacetic acid
+
−
** o-hydroxyphenylacetate
+
−
** o-hydroxyphenylacetic acid
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
* '''2''' reaction(s) found
−
* [[RXN-10815]]
+
** [[RXN-8162]]
−
== Reaction(s) of unknown directionality ==
+
** [[2-AMINOADIPATE-AMINOTRANSFERASE-RXN]]
 +
== Reaction(s) not found ==
 +
* '''7''' reaction(s) not found
 +
** [http://metacyc.org/META/NEW-IMAGE?object=L-PIPECOLATE-OXIDASE-RXN L-PIPECOLATE-OXIDASE-RXN]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=LYSINE-RACEMASE-RXN LYSINE-RACEMASE-RXN]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-8163 RXN-8163]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-8166 RXN-8166]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-8167 RXN-8167]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-14724 RXN-14724]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-8172 RXN-8172]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6933325 6933325]
+
{{#set: common name=L-lysine degradation V}}
−
* CHEMSPIDER:
+
{{#set: common name=2-aminoadipate pathway}}
−
** [http://www.chemspider.com/Chemical-Structure.5307390.html 5307390]
+
{{#set: reaction found=2}}
−
* CHEBI:
+
{{#set: reaction not found=7}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62423 62423]
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C05852 C05852]
+
−
* HMDB : HMDB00669
+
−
{{#set: smiles=C(=O)([O-])CC1(=CC=CC=C(O)1)}}
+
−
{{#set: inchi key=InChIKey=CCVYRRGZDBSHFU-UHFFFAOYSA-M}}
+
−
{{#set: common name=2-hydroxyphenylacetate}}
+
−
{{#set: molecular weight=151.141    }}
+
−
{{#set: common name=2-hydroxyphenylacetic acid|benzeneacetic acid, 2-hydroxy-|2-hydroxybenzeneacetic acid|acetic acid, (o-hydroxyphenyl)-|o-hydroxy phenylacetic acid|o-hydroxyphenylacetate|o-hydroxyphenylacetic acid}}
+
−
{{#set: produced by=RXN-10815}}
+

Revision as of 15:52, 10 January 2018

Pathway PWY-5283

  • taxonomic range:
  • common name:
    • L-lysine degradation V
  • Synonym(s):
    • 2-aminoadipate pathway

Reaction(s) found

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_11334&oldid=10736"