Difference between revisions of "PWY-7224"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7014 CPD-7014] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Mitogen-Activated-Protein-Kinase-L-Thr Mitogen-Activated-Protein-Kinase-L-Thr] == * common name...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7014 CPD-7014] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Mitogen-Activated-Protein-Kinase-L-Thr Mitogen-Activated-Protein-Kinase-L-Thr] ==
* smiles:
+
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
 
* common name:
 
* common name:
** chlorophyllide b
+
** a [mitogen-activated protein kinase]-L-threonine
* molecular weight:
+
** 626.95   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7674]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7677]]
 
* [[RXN-13398]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-7673]]
+
* [[2.7.12.2-RXN]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a [mitogen-activated protein kinase]-L-threonine}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658741 90658741]
+
{{#set: consumed or produced by=2.7.12.2-RXN}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58686 58686]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C16541 C16541]
+
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
{{#set: common name=chlorophyllide b}}
+
{{#set: molecular weight=626.95    }}
+
{{#set: consumed by=RXN-7674}}
+
{{#set: produced by=RXN-7677|RXN-13398}}
+
{{#set: consumed or produced by=RXN-7673}}
+

Revision as of 15:53, 10 January 2018

Metabolite Mitogen-Activated-Protein-Kinase-L-Thr

  • common name:
    • a [mitogen-activated protein kinase]-L-threonine
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a [mitogen-activated protein kinase]-L-threonine" cannot be used as a page name in this wiki.