Difference between revisions of "PWY-7442"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_9453 == * left end position: ** 1044 * transcription direction: ** POSITIVE * right end position: ** 5927 * centisome position: ** 11.17773...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11495 CPD-11495] == * smiles: ** C(=O)([O-])CC1(=CC=CC=C(O)1) * inchi key: ** InChIKey=CCVY...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11495 CPD-11495] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(=O)([O-])CC1(=CC=CC=C(O)1) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=CCVYRRGZDBSHFU-UHFFFAOYSA-M |
| − | * | + | * common name: |
| − | ** | + | ** 2-hydroxyphenylacetate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 151.141 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 2-hydroxyphenylacetic acid | ||
| + | ** benzeneacetic acid, 2-hydroxy- | ||
| + | ** 2-hydroxybenzeneacetic acid | ||
| + | ** acetic acid, (o-hydroxyphenyl)- | ||
| + | ** o-hydroxy phenylacetic acid | ||
| + | ** o-hydroxyphenylacetate | ||
| + | ** o-hydroxyphenylacetic acid | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-10815]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6933325 6933325] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.5307390.html 5307390] |
| − | {{#set: | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62423 62423] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C05852 C05852] | ||
| + | * HMDB : HMDB00669 | ||
| + | {{#set: smiles=C(=O)([O-])CC1(=CC=CC=C(O)1)}} | ||
| + | {{#set: inchi key=InChIKey=CCVYRRGZDBSHFU-UHFFFAOYSA-M}} | ||
| + | {{#set: common name=2-hydroxyphenylacetate}} | ||
| + | {{#set: molecular weight=151.141 }} | ||
| + | {{#set: common name=2-hydroxyphenylacetic acid|benzeneacetic acid, 2-hydroxy-|2-hydroxybenzeneacetic acid|acetic acid, (o-hydroxyphenyl)-|o-hydroxy phenylacetic acid|o-hydroxyphenylacetate|o-hydroxyphenylacetic acid}} | ||
| + | {{#set: produced by=RXN-10815}} | ||
Revision as of 16:53, 10 January 2018
Contents
Metabolite CPD-11495
- smiles:
- C(=O)([O-])CC1(=CC=CC=C(O)1)
- inchi key:
- InChIKey=CCVYRRGZDBSHFU-UHFFFAOYSA-M
- common name:
- 2-hydroxyphenylacetate
- molecular weight:
- 151.141
- Synonym(s):
- 2-hydroxyphenylacetic acid
- benzeneacetic acid, 2-hydroxy-
- 2-hydroxybenzeneacetic acid
- acetic acid, (o-hydroxyphenyl)-
- o-hydroxy phenylacetic acid
- o-hydroxyphenylacetate
- o-hydroxyphenylacetic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)([O-])CC1(=CC=CC=C(O)1)" cannot be used as a page name in this wiki.
