Difference between revisions of "Tiso gene 13785"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYLACETATE PHENYLACETATE] == * smiles: ** C1(=CC=C(C=C1)CC([O-])=O) * inchi key: ** InChIKey...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5353 PWY-5353] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYLACETATE PHENYLACETATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5353 PWY-5353] ==
−
* smiles:
+
* taxonomic range:
−
** C1(=CC=C(C=C1)CC([O-])=O)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3041 TAX-3041]
−
** InChIKey=WLJVXDMOQOGPHL-UHFFFAOYSA-M
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3208 TAX-3208]
 
* common name:
 
* common name:
−
** phenylacetate
+
** arachidonate biosynthesis I (6-desaturase, lower eukaryotes)
−
* molecular weight:
+
−
** 135.142   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2-phenylacetate
+
** arachidonic acid biosynthesis I (lower eukaryotes)
−
** benzeneacetic acid
+
−
** phenylacetic acid
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
* '''3''' reaction(s) found
−
== Reaction(s) of unknown directionality ==
+
** [[RXN-8346]]
−
* [[PHENDEHYD-RXN]]
+
** [[RXN-11680]]
 +
** [[RXN-12968]]
 +
== Reaction(s) not found ==
 +
* '''5''' reaction(s) not found
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-12971 RXN-12971]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-16044 RXN-16044]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-12969 RXN-12969]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-12777 RXN-12777]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-16043 RXN-16043]
 
== External links  ==
 
== External links  ==
−
* CAS : 103-82-2
+
{{#set: taxonomic range=TAX-4751}}
−
* Wikipedia : Phenylacetic_acid
+
{{#set: taxonomic range=TAX-3041}}
−
* METABOLIGHTS : MTBLC18401
+
{{#set: taxonomic range=TAX-3208}}
−
* PUBCHEM:
+
{{#set: common name=arachidonate biosynthesis I (6-desaturase, lower eukaryotes)}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4409936 4409936]
+
{{#set: common name=arachidonic acid biosynthesis I (lower eukaryotes)}}
−
* HMDB : HMDB00209
+
{{#set: reaction found=3}}
−
* LIGAND-CPD:
+
{{#set: reaction not found=5}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C07086 C07086]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.3610724.html 3610724]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18401 18401]
+
−
* BIGG : pac
+
−
{{#set: smiles=C1(=CC=C(C=C1)CC([O-])=O)}}
+
−
{{#set: inchi key=InChIKey=WLJVXDMOQOGPHL-UHFFFAOYSA-M}}
+
−
{{#set: common name=phenylacetate}}
+
−
{{#set: molecular weight=135.142    }}
+
−
{{#set: common name=2-phenylacetate|benzeneacetic acid|phenylacetic acid}}
+
−
{{#set: consumed or produced by=PHENDEHYD-RXN}}
+

Revision as of 16:56, 10 January 2018

Pathway PWY-5353

  • taxonomic range:
  • common name:
    • arachidonate biosynthesis I (6-desaturase, lower eukaryotes)
  • Synonym(s):
    • arachidonic acid biosynthesis I (lower eukaryotes)

Reaction(s) found

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_13785&oldid=10966"