Difference between revisions of "PWY-6333"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5721 CPD-5721] == * smiles: ** C1(N=C2(N=C(N)N=C([S-])C(N=1)2)) * inchi key: ** InChIKey=UH...") |
(Created page with "Category:Gene == Gene Tiso_gene_3617 == * Synonym(s): == Reactions associated == * ACETATE--COA-LIGASE-RXN ** in-silico_annotation ***ec-number ** pantograph-es...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_3617 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == | + | == Reactions associated == |
| − | + | * [[ACETATE--COA-LIGASE-RXN]] | |
| − | == | + | ** in-silico_annotation |
| − | * [[ | + | ***ec-number |
| + | ** [[pantograph]]-[[esiliculosus]] | ||
| + | ** [[pantograph]]-[[creinhardtii]] | ||
| + | == Pathways associated == | ||
| + | * [[PWY66-161]] | ||
| + | * [[PWY66-21]] | ||
| + | * [[PWY66-162]] | ||
| + | * [[PWY0-1313]] | ||
| + | * [[PWY-6672]] | ||
| + | * [[PWY-7118]] | ||
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=ACETATE--COA-LIGASE-RXN}} | |
| − | + | {{#set: pathway associated=PWY66-161|PWY66-21|PWY66-162|PWY0-1313|PWY-6672|PWY-7118}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
Revision as of 15:57, 10 January 2018
Gene Tiso_gene_3617
- Synonym(s):
Reactions associated
- ACETATE--COA-LIGASE-RXN
- in-silico_annotation
- ec-number
- pantograph-esiliculosus
- pantograph-creinhardtii
- in-silico_annotation
