Difference between revisions of "RXN-4821"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15692 CPD-15692] == * smiles: ** CCCCCCC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-133 CPD1F-133] == * smiles: ** CC(=CC=CC=C(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))C)C=CC...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-133 CPD1F-133] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC(=CC=CC=C(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))C)C=CC=C(C)C=CC34(C(C)(C)CC(O)CC(O3)(C)4) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=SZCBXWMUOPQSOX-WVJDLNGLSA-N |
* common name: | * common name: | ||
| − | ** | + | ** violaxanthin |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 600.88 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 5,6,5',6'-diepoxy-5,6,5',6'-tetrahydro-β,β-carotene-3,3'-diol |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-7984]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-7979]] |
| + | * [[RXN-13193]] | ||
| + | * [[ANXANor]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-13185]] | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=448438 448438] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=35288 35288] |
| − | {{#set: smiles= | + | * LIGAND-CPD: |
| − | {{#set: inchi key=InChIKey= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C08614 C08614] |
| − | {{#set: common name= | + | * HMDB : HMDB03101 |
| − | {{#set: molecular weight= | + | {{#set: smiles=CC(=CC=CC=C(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))C)C=CC=C(C)C=CC34(C(C)(C)CC(O)CC(O3)(C)4)}} |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=SZCBXWMUOPQSOX-WVJDLNGLSA-N}} |
| − | {{#set: produced by=RXN- | + | {{#set: common name=violaxanthin}} |
| + | {{#set: molecular weight=600.88 }} | ||
| + | {{#set: common name=5,6,5',6'-diepoxy-5,6,5',6'-tetrahydro-β,β-carotene-3,3'-diol}} | ||
| + | {{#set: consumed by=RXN-7984}} | ||
| + | {{#set: produced by=RXN-7979|RXN-13193|ANXANor}} | ||
| + | {{#set: consumed or produced by=RXN-13185}} | ||
Revision as of 15:57, 10 January 2018
Contents
Metabolite CPD1F-133
- smiles:
- CC(=CC=CC=C(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))C)C=CC=C(C)C=CC34(C(C)(C)CC(O)CC(O3)(C)4)
- inchi key:
- InChIKey=SZCBXWMUOPQSOX-WVJDLNGLSA-N
- common name:
- violaxanthin
- molecular weight:
- 600.88
- Synonym(s):
- 5,6,5',6'-diepoxy-5,6,5',6'-tetrahydro-β,β-carotene-3,3'-diol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
