Difference between revisions of "Tiso gene 7260"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-548 CPD-548] == * smiles: ** C(NC(=O)C(CSC=O)NC(=O)CCC([N+])C(=O)[O-])C(=O)[O-] * inchi key...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACETYL-COA-CARBOXYLTRANSFER-RXN ACETYL-COA-CARBOXYLTRANSFER-RXN] == * direction: ** LEFT-TO-RIGHT *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACETYL-COA-CARBOXYLTRANSFER-RXN ACETYL-COA-CARBOXYLTRANSFER-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/6.4.1.2 EC-6.4.1.2] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[HCO3]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[ACETYL-COA]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[Pi]][c] '''+''' 1 [[MALONYL-COA]][c] '''+''' 1 [[PROTON]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 hydrogencarbonate[c] '''+''' 1 ATP[c] '''+''' 1 acetyl-CoA[c] '''=>''' 1 ADP[c] '''+''' 1 phosphate[c] '''+''' 1 malonyl-CoA[c] '''+''' 1 H+[c] |
− | * [[ | + | |
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[Tiso_gene_2812]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[Tiso_gene_7965]] | ||
+ | ** EXPERIMENTAL_ANNOTATION | ||
+ | ***AUTOMATED-NAME-MATCH | ||
+ | ** [[pantograph]]-[[athaliana]] | ||
+ | ** [[pantograph]]-[[athaliana]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[Tiso_gene_3800]] | ||
+ | ** EXPERIMENTAL_ANNOTATION | ||
+ | ***AUTOMATED-NAME-MATCH | ||
+ | ** [[pantograph]]-[[athaliana]] | ||
+ | ** [[pantograph]]-[[athaliana]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[Tiso_gene_5029]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY-7388]], octanoyl-[acyl-carrier protein] biosynthesis (mitochondria, yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7388 PWY-7388] | ||
+ | ** '''9''' reactions found over '''9''' reactions in the full pathway | ||
+ | * [[PWY-5789]], 3-hydroxypropanoate/4-hydroxybutanate cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5789 PWY-5789] | ||
+ | ** '''8''' reactions found over '''16''' reactions in the full pathway | ||
+ | * [[PWY-5743]], 3-hydroxypropanoate cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5743 PWY-5743] | ||
+ | ** '''4''' reactions found over '''11''' reactions in the full pathway | ||
+ | * [[PWY-5744]], glyoxylate assimilation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5744 PWY-5744] | ||
+ | ** '''2''' reactions found over '''11''' reactions in the full pathway | ||
+ | * [[PWY-6722]], candicidin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6722 PWY-6722] | ||
+ | ** '''1''' reactions found over '''6''' reactions in the full pathway | ||
+ | * [[PWY-6679]], jadomycin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6679 PWY-6679] | ||
+ | ** '''1''' reactions found over '''9''' reactions in the full pathway | ||
+ | * [[PWY-4381]], fatty acid biosynthesis initiation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4381 PWY-4381] | ||
+ | ** '''3''' reactions found over '''3''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * [[orthology]]: | ||
+ | ** [[pantograph]]: | ||
+ | *** [[esiliculosus]] | ||
+ | *** [[athaliana]] | ||
+ | * [[manual]]: | ||
+ | ** [[primary_network]] | ||
+ | * [[annotation]]: | ||
+ | ** [[pathwaytools]]: | ||
+ | *** [[experimental_annotation]] | ||
+ | *** [[in-silico_annotation]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=11308 11308] | |
− | ** [http:// | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00742 R00742] | |
− | * LIGAND- | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: ec number=EC-6.4.1.2}} |
− | + | {{#set: gene associated=Tiso_gene_2812|Tiso_gene_7965|Tiso_gene_3800|Tiso_gene_5029}} | |
− | + | {{#set: in pathway=PWY-7388|PWY-5789|PWY-5743|PWY-5744|PWY-6722|PWY-6679|PWY-4381}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
− | {{#set: | + | {{#set: reconstruction source=esiliculosus|athaliana}} |
− | {{#set: | + | {{#set: reconstruction category=manual}} |
− | {{#set: | + | {{#set: reconstruction source=primary_network}} |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | {{#set: reconstruction source=experimental_annotation|in-silico_annotation}} |
Revision as of 16:58, 10 January 2018
Contents
Reaction ACETYL-COA-CARBOXYLTRANSFER-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 HCO3[c] + 1 ATP[c] + 1 ACETYL-COA[c] => 1 ADP[c] + 1 Pi[c] + 1 MALONYL-COA[c] + 1 PROTON[c]
- With common name(s):
- 1 hydrogencarbonate[c] + 1 ATP[c] + 1 acetyl-CoA[c] => 1 ADP[c] + 1 phosphate[c] + 1 malonyl-CoA[c] + 1 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Tiso_gene_2812
- Tiso_gene_7965
- EXPERIMENTAL_ANNOTATION
- AUTOMATED-NAME-MATCH
- pantograph-athaliana
- pantograph-athaliana
- pantograph-esiliculosus
- EXPERIMENTAL_ANNOTATION
- Tiso_gene_3800
- EXPERIMENTAL_ANNOTATION
- AUTOMATED-NAME-MATCH
- pantograph-athaliana
- pantograph-athaliana
- pantograph-esiliculosus
- EXPERIMENTAL_ANNOTATION
- Tiso_gene_5029
Pathways
- PWY-7388, octanoyl-[acyl-carrier protein] biosynthesis (mitochondria, yeast): PWY-7388
- 9 reactions found over 9 reactions in the full pathway
- PWY-5789, 3-hydroxypropanoate/4-hydroxybutanate cycle: PWY-5789
- 8 reactions found over 16 reactions in the full pathway
- PWY-5743, 3-hydroxypropanoate cycle: PWY-5743
- 4 reactions found over 11 reactions in the full pathway
- PWY-5744, glyoxylate assimilation: PWY-5744
- 2 reactions found over 11 reactions in the full pathway
- PWY-6722, candicidin biosynthesis: PWY-6722
- 1 reactions found over 6 reactions in the full pathway
- PWY-6679, jadomycin biosynthesis: PWY-6679
- 1 reactions found over 9 reactions in the full pathway
- PWY-4381, fatty acid biosynthesis initiation I: PWY-4381
- 3 reactions found over 3 reactions in the full pathway
Reconstruction information
External links