Difference between revisions of "Tiso gene 10345"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMP IMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23))) * inchi k...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6525 PWY-6525] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3568 TAX-35...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6525 PWY-6525] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3568 TAX-3568] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** stellariose and mediose biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** galactosyl-oligosaccharides biosynthesis |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * | + | * '''1''' reaction(s) found |
− | * | + | ** [[2.4.1.123-RXN]] |
− | * [[ | + | == Reaction(s) not found == |
− | == Reaction(s) | + | * '''4''' reaction(s) not found |
− | * [ | + | ** [http://metacyc.org/META/NEW-IMAGE?object=2.4.1.82-RXN 2.4.1.82-RXN] |
− | + | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-11492 RXN-11492] | |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-11491 RXN-11491] |
− | * [ | + | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-11490 RXN-11490] |
− | + | ||
− | * [ | + | |
− | = | + | |
− | + | ||
− | * [ | + | |
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-3568}} | |
− | + | {{#set: common name=stellariose and mediose biosynthesis}} | |
− | + | {{#set: common name=galactosyl-oligosaccharides biosynthesis}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: reaction not found=4}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 15:58, 10 January 2018
Pathway PWY-6525
- taxonomic range:
- common name:
- stellariose and mediose biosynthesis
- Synonym(s):
- galactosyl-oligosaccharides biosynthesis
Reaction(s) found
- 1 reaction(s) found
Reaction(s) not found
- 4 reaction(s) not found