Difference between revisions of "1.14.11.18-RXN"

Revision as of 15:59, 10 January 2018

"CC(=O)NC1(=CC([CH]=O)=CC=C([O-])1)" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Me-Branched-234-Sat-Fatty-Acyl-CoA 2-Me-Branched-234-Sat-Fatty-Acyl-CoA] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14876 CPD-14876] ==
+* smiles:
+** CC(=O)NC1(=CC([CH]=O)=CC=C([O-])1)
+* inchi key:
+** InChIKey=ODYOPAJBVPISJD-UHFFFAOYSA-M
 * common name:
-** a 2-methyl branched 2,3,4-saturated fatty acyl-CoA
+** 3-acetylamino-4-hydroxybenzaldehyde
+* molecular weight:
+** 178.167
 * Synonym(s):
 == Reaction(s) known to consume the compound ==
 == Reaction(s) known to produce the compound ==
-* [[RXN66-483]]
 == Reaction(s) of unknown directionality ==
+* [[RXN-13871]]
 == External links  ==
-{{#set: common name=a 2-methyl branched 2,3,4-saturated fatty acyl-CoA}}
+* PUBCHEM:
-{{#set: produced by=RXN66-483}}
+** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657664 90657664]
+{{#set: smiles=CC(=O)NC1(=CC([CH]=O)=CC=C([O-])1)}}
+{{#set: inchi key=InChIKey=ODYOPAJBVPISJD-UHFFFAOYSA-M}}
+{{#set: common name=3-acetylamino-4-hydroxybenzaldehyde}}
+{{#set: molecular weight=178.167    }}
+{{#set: consumed or produced by=RXN-13871}}