Difference between revisions of "PWY-6605"

Revision as of 16:59, 10 January 2018

"C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
-[[Category:Gene]]
+[[Category:Metabolite]]
-== Gene Tiso_gene_19256 ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6701 CPD-6701] ==
-* left end position:
+* smiles:
-** 33
+** C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)
-* transcription direction:
+* inchi key:
-** POSITIVE
+** InChIKey=INAPMGSXUVUWAF-KXXVROSKSA-L
-* right end position:
+* common name:
-** 1573
+** 1D-myo-inositol 5-monophosphate
-* centisome position:
+* molecular weight:
-** 1.3311819
+** 258.121
 * Synonym(s):
+** D-myo-inositol 5-monophosphate
+** Ins(5)P1
+** 1D-myo-inositol 5-phosphate
+** Ins(5)P
+** Ins5P
-== Reactions associated ==
+== Reaction(s) known to consume the compound ==
-* [[2.4.2.31-RXN]]
+* [[RXN-10953]]
-** in-silico_annotation
+== Reaction(s) known to produce the compound ==
-***ec-number
+== Reaction(s) of unknown directionality ==
-== Pathways associated ==
 == External links  ==
-{{#set: left end position=33}}
+{{#set: smiles=C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)}}
-{{#set: transcription direction=POSITIVE}}
+{{#set: inchi key=InChIKey=INAPMGSXUVUWAF-KXXVROSKSA-L}}
-{{#set: right end position=1573}}
+{{#set: common name=1D-myo-inositol 5-monophosphate}}
-{{#set: centisome position=1.3311819    }}
+{{#set: molecular weight=258.121    }}
-{{#set: reaction associated=2.4.2.31-RXN}}
+{{#set: common name=D-myo-inositol 5-monophosphate|Ins(5)P1|1D-myo-inositol 5-phosphate|Ins(5)P|Ins5P}}
+{{#set: consumed by=RXN-10953}}