Difference between revisions of "CYSTATHIONINE-BETA-SYNTHASE-RXN"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6927 PWY-6927] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8222 CPD-8222] == * smiles: ** C=C(C1(CC(C(CC1)(C)O)O))C * inchi key: ** InChIKey=WKZWTZTZW...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8222 CPD-8222] == |
− | * | + | * smiles: |
− | ** | + | ** C=C(C1(CC(C(CC1)(C)O)O))C |
+ | * inchi key: | ||
+ | ** InChIKey=WKZWTZTZWGWEGE-UTLUCORTSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** (1S,2S,4R)-limonene-1,2-diol |
+ | * molecular weight: | ||
+ | ** 170.251 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** (1R,2R,4S)-menth-8-ene-1,2-diol | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[3.3.2.8-RXN]] | |
− | == Reaction(s) | + | == Reaction(s) of unknown directionality == |
− | + | * [[RXN-9464]] | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * UM-BBD-CPD : c0673 |
− | * | + | * LIPID_MAPS : LMPR0102090016 |
− | ** [http:// | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=441246 441246] |
− | {{#set: common name= | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C07276 C07276] |
− | {{#set: | + | * CHEMSPIDER: |
+ | ** [http://www.chemspider.com/Chemical-Structure.390019.html 390019] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18515 18515] | ||
+ | {{#set: smiles=C=C(C1(CC(C(CC1)(C)O)O))C}} | ||
+ | {{#set: inchi key=InChIKey=WKZWTZTZWGWEGE-UTLUCORTSA-N}} | ||
+ | {{#set: common name=(1S,2S,4R)-limonene-1,2-diol}} | ||
+ | {{#set: molecular weight=170.251 }} | ||
+ | {{#set: common name=(1R,2R,4S)-menth-8-ene-1,2-diol}} | ||
+ | {{#set: produced by=3.3.2.8-RXN}} | ||
+ | {{#set: consumed or produced by=RXN-9464}} |
Revision as of 17:00, 10 January 2018
Contents
Metabolite CPD-8222
- smiles:
- C=C(C1(CC(C(CC1)(C)O)O))C
- inchi key:
- InChIKey=WKZWTZTZWGWEGE-UTLUCORTSA-N
- common name:
- (1S,2S,4R)-limonene-1,2-diol
- molecular weight:
- 170.251
- Synonym(s):
- (1R,2R,4S)-menth-8-ene-1,2-diol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- UM-BBD-CPD : c0673
- LIPID_MAPS : LMPR0102090016
- PUBCHEM:
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI: