Difference between revisions of "Tiso gene 9166"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-Acylsphingosine N-Acylsphingosine] == * common name: ** a sphingosine ceramide * Synonym(s):...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7417 CPD-7417] == * smiles: ** C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O * inchi ke...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7417 CPD-7417] == |
| + | * smiles: | ||
| + | ** C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O | ||
| + | * inchi key: | ||
| + | ** InChIKey=GVRIYIMNJGULCZ-QLFWQTQQSA-M | ||
* common name: | * common name: | ||
| − | ** | + | ** cis-coumarinic acid-β-D-glucoside |
| + | * molecular weight: | ||
| + | ** 325.294 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** coumarinic acid glucoside |
| − | ** | + | ** coumarinate glucoside |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-8036]] |
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05839 C05839] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62223 62223] |
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25796113 25796113] | ||
| + | * HMDB : HMDB60077 | ||
| + | {{#set: smiles=C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O}} | ||
| + | {{#set: inchi key=InChIKey=GVRIYIMNJGULCZ-QLFWQTQQSA-M}} | ||
| + | {{#set: common name=cis-coumarinic acid-β-D-glucoside}} | ||
| + | {{#set: molecular weight=325.294 }} | ||
| + | {{#set: common name=coumarinic acid glucoside|coumarinate glucoside}} | ||
| + | {{#set: consumed by=RXN-8036}} | ||
Revision as of 17:02, 10 January 2018
Contents
Metabolite CPD-7417
- smiles:
- C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O
- inchi key:
- InChIKey=GVRIYIMNJGULCZ-QLFWQTQQSA-M
- common name:
- cis-coumarinic acid-β-D-glucoside
- molecular weight:
- 325.294
- Synonym(s):
- coumarinic acid glucoside
- coumarinate glucoside
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O" cannot be used as a page name in this wiki.
