Difference between revisions of "Tiso gene 575"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15651 CPD-15651] == * smiles: ** CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-21 PWY66-21] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15651 CPD-15651] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-21 PWY66-21] ==
* smiles:
+
* taxonomic range:
** CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
** InChIKey=UUIVZEBYPBPKLL-HMXWSVNBSA-J
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
 
* common name:
 
* common name:
** 6-trans-tridecenoyl-CoA
+
** ethanol degradation II
* molecular weight:
+
** 957.819   
+
 
* Synonym(s):
 
* Synonym(s):
** 6E-tridecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-14785]]
+
* '''3''' reaction(s) found
== Reaction(s) known to produce the compound ==
+
** [[ALCOHOL-DEHYDROG-RXN]]
== Reaction(s) of unknown directionality ==
+
** [[ACETATE--COA-LIGASE-RXN]]
 +
** [[RXN66-3]]
 +
== Reaction(s) not found ==
 +
* '''0''' reaction(s) not found
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2759}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658572 90658572]
+
{{#set: taxonomic range=TAX-2}}
{{#set: smiles=CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: taxonomic range=TAX-2157}}
{{#set: inchi key=InChIKey=UUIVZEBYPBPKLL-HMXWSVNBSA-J}}
+
{{#set: common name=ethanol degradation II}}
{{#set: common name=6-trans-tridecenoyl-CoA}}
+
{{#set: reaction found=3}}
{{#set: molecular weight=957.819    }}
+
{{#set: reaction not found=0}}
{{#set: common name=6E-tridecenoyl-CoA}}
+
{{#set: consumed by=RXN-14785}}
+

Revision as of 16:02, 10 January 2018

Pathway PWY66-21

Reaction(s) found

Reaction(s) not found

  • 0 reaction(s) not found

External links