Difference between revisions of "RXN-12776"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=IDS1 IDS1] == * direction: ** LEFT-TO-RIGHT * common name: ** isopentenyl-diphosphate synthase * Sy...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-591 CPD-591] == * smiles: ** C3(C(C1(C(=CC2(=C([O-])C=C(O)C=C([O+]=1)2))[O-]))=CC(O)=C(C=3)...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=IDS1 IDS1] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-591 CPD-591] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C3(C(C1(C(=CC2(=C([O-])C=C(O)C=C([O+]=1)2))[O-]))=CC(O)=C(C=3)O)
 +
* inchi key:
 +
** InChIKey=VEVZSMAEJFVWIL-UHFFFAOYSA-M
 
* common name:
 
* common name:
−
** isopentenyl-diphosphate synthase
+
** cyanidin
 +
* molecular weight:
 +
** 285.232   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-1-Benzopyrylium
 +
** 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromenylium
 +
** 3,3',4',5,7-pentahydroxyflavylium
 +
** cyanidol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-9725]]
−
** 1.0 [[PROTON]][h] '''+''' 1.0 [[NADPH]][h] '''+''' 1.0 [[HYDROXY-METHYL-BUTENYL-DIP]][h] '''=>''' 1.0 [[NADP]][h] '''+''' 1.0 [[DELTA3-ISOPENTENYL-PP]][h] '''+''' 1.0 [[WATER]][h]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-602]]
−
** 1.0 H+[h] '''+''' 1.0 NADPH[h] '''+''' 1.0 (E)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate[h] '''=>''' 1.0 NADP+[h] '''+''' 1.0 isopentenyl diphosphate[h] '''+''' 1.0 H2O[h]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_5609]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=isopentenyl-diphosphate synthase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202542 25202542]
−
{{#set: gene associated=Tiso_gene_5609}}
+
* CHEBI:
−
{{#set: in pathway=}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71682 71682]
−
{{#set: reconstruction category=orthology}}
+
* LIGAND-CPD:
−
{{#set: reconstruction tool=pantograph}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C05905 C05905]
−
{{#set: reconstruction source=creinhardtii}}
+
* HMDB : HMDB02708
 +
{{#set: smiles=C3(C(C1(C(=CC2(=C([O-])C=C(O)C=C([O+]=1)2))[O-]))=CC(O)=C(C=3)O)}}
 +
{{#set: inchi key=InChIKey=VEVZSMAEJFVWIL-UHFFFAOYSA-M}}
 +
{{#set: common name=cyanidin}}
 +
{{#set: molecular weight=285.232    }}
 +
{{#set: common name=2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-1-Benzopyrylium|2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromenylium|3,3',4',5,7-pentahydroxyflavylium|cyanidol}}
 +
{{#set: consumed by=RXN-9725}}
 +
{{#set: produced by=RXN-602}}

Revision as of 16:05, 10 January 2018

Metabolite CPD-591

  • smiles:
    • C3(C(C1(C(=CC2(=C([O-])C=C(O)C=C([O+]=1)2))[O-]))=CC(O)=C(C=3)O)
  • inchi key:
    • InChIKey=VEVZSMAEJFVWIL-UHFFFAOYSA-M
  • common name:
    • cyanidin
  • molecular weight:
    • 285.232
  • Synonym(s):
    • 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-1-Benzopyrylium
    • 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromenylium
    • 3,3',4',5,7-pentahydroxyflavylium
    • cyanidol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C3(C(C1(C(=CC2(=C([O-])C=C(O)C=C([O+]=1)2))[O-]))=CC(O)=C(C=3)O)" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-12776&oldid=11524"