Difference between revisions of "Trans-D2-cis-cis-D15-33-C52-3-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Purine-Bases Purine-Bases] == * common name: ** a purine base * Synonym(s): ** purine base ==...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MYRICETIN MYRICETIN] == * smiles: ** C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Purine-Bases Purine-Bases] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MYRICETIN MYRICETIN] ==
 +
* smiles:
 +
** C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=3)))
 +
* inchi key:
 +
** InChIKey=IKMDFBPHZNJCSN-UHFFFAOYSA-M
 
* common name:
 
* common name:
** a purine base
+
** myricetin
 +
* molecular weight:
 +
** 317.231   
 
* Synonym(s):
 
* Synonym(s):
** purine base
+
** myricitin
 +
** cannabiscetin
 +
** myricetol
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PURINE-NUCLEOSIDASE-RXN]]
+
* [[RXN-8450]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a purine base}}
+
* PUBCHEM:
{{#set: common name=purine base}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201643 25201643]
{{#set: produced by=PURINE-NUCLEOSIDASE-RXN}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58395 58395]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C10107 C10107]
 +
* HMDB : HMDB02755
 +
{{#set: smiles=C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=3)))}}
 +
{{#set: inchi key=InChIKey=IKMDFBPHZNJCSN-UHFFFAOYSA-M}}
 +
{{#set: common name=myricetin}}
 +
{{#set: molecular weight=317.231    }}
 +
{{#set: common name=myricitin|cannabiscetin|myricetol}}
 +
{{#set: produced by=RXN-8450}}

Revision as of 17:05, 10 January 2018

Metabolite MYRICETIN

  • smiles:
    • C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=3)))
  • inchi key:
    • InChIKey=IKMDFBPHZNJCSN-UHFFFAOYSA-M
  • common name:
    • myricetin
  • molecular weight:
    • 317.231
  • Synonym(s):
    • myricitin
    • cannabiscetin
    • myricetol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=3)))" cannot be used as a page name in this wiki.