Difference between revisions of "Tiso gene 10771"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINAL HISTIDINAL] == * smiles: ** C1(NC=NC=1CC([CH]=O)[N+]) * inchi key: ** InChIKey=VYOIE...") |
(Created page with "Category:Gene == Gene Tiso_gene_4530 == * Synonym(s): == Reactions associated == * RXN-15684 ** in-silico_annotation ***automated-name-match * THIOL-OXIDASE-RXN *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_4530 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[RXN-15684]] |
− | + | ** in-silico_annotation | |
− | == | + | ***automated-name-match |
− | * [[ | + | * [[THIOL-OXIDASE-RXN]] |
+ | ** in-silico_annotation | ||
+ | ***automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7533]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=RXN-15684|THIOL-OXIDASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-7533}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + |
Revision as of 16:06, 10 January 2018
Gene Tiso_gene_4530
- Synonym(s):
Reactions associated
- RXN-15684
- in-silico_annotation
- automated-name-match
- in-silico_annotation
- THIOL-OXIDASE-RXN
- in-silico_annotation
- automated-name-match
- in-silico_annotation