Difference between revisions of "Tiso gene 10066"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18011 CPD-18011] == * smiles: ** C(C(OC1(OC(C(O)C(C1O)O)CO))COP([O-])([O-])=O)O * inchi key...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14125 RXN-14125] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14125 RXN-14125] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/4.2.3 EC-4.2.3] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | == | + | * With identifiers: |
| − | == | + | ** 1 [[4-PHOSPHONOOXY-THREONINE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD0-2189]][c] '''+''' 1 [[Pi]][c] |
| − | * [[ | + | * With common name(s): |
| + | ** 1 4-phospho-hydroxy-L-threonine[c] '''+''' 1 H2O[c] '''=>''' 1 4-hydroxy-L-threonine[c] '''+''' 1 phosphate[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * [[Tiso_gene_12871]] | ||
| + | ** [[pantograph]]-[[athaliana]] | ||
| + | * [[Tiso_gene_419]] | ||
| + | ** [[pantograph]]-[[esiliculosus]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * [[orthology]]: | ||
| + | ** [[pantograph]]: | ||
| + | *** [[athaliana]] | ||
| + | *** [[esiliculosus]] | ||
== External links == | == External links == | ||
| − | * | + | * RHEA: |
| − | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30662 30662] |
| − | * | + | * LIGAND-RXN: |
| − | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?R05086 R05086] |
| − | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
| − | {{#set: | + | {{#set: ec number=EC-4.2.3}} |
| − | {{#set: | + | {{#set: gene associated=Tiso_gene_12871|Tiso_gene_419}} |
| − | {{#set: | + | {{#set: in pathway=}} |
| − | {{#set: | + | {{#set: reconstruction category=orthology}} |
| + | {{#set: reconstruction tool=pantograph}} | ||
| + | {{#set: reconstruction source=athaliana|esiliculosus}} | ||
Revision as of 16:08, 10 January 2018
Contents
Reaction RXN-14125
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 4-PHOSPHONOOXY-THREONINE[c] + 1 WATER[c] => 1 CPD0-2189[c] + 1 Pi[c]
- With common name(s):
- 1 4-phospho-hydroxy-L-threonine[c] + 1 H2O[c] => 1 4-hydroxy-L-threonine[c] + 1 phosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
Reconstruction information
External links
