Difference between revisions of "PWY1F-823"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRISTANATE PRISTANATE] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C([O-])=O)C)C)C * inchi key: ** InCh...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=LONG-CHAIN-FATTY-ACYL-COA-REDUCTASE-RXN LONG-CHAIN-FATTY-ACYL-COA-REDUCTASE-RXN] == * direction: **...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=LONG-CHAIN-FATTY-ACYL-COA-REDUCTASE-RXN LONG-CHAIN-FATTY-ACYL-COA-REDUCTASE-RXN] == |
− | + | * direction: | |
− | + | ** REVERSIBLE | |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/1.2.1.50 EC-1.2.1.50] | |
− | * | + | |
− | ** | + | |
− | * | + | |
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[NADP]][c] '''+''' 1 [[Long-Chain-Aldehydes]][c] '''+''' 1 [[CO-A]][c] '''<=>''' 1 [[Long-Chain-Acyl-CoAs]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] |
− | == | + | * With common name(s): |
+ | ** 1 NADP+[c] '''+''' 1 a long-chain aldehyde[c] '''+''' 1 coenzyme A[c] '''<=>''' 1 a long-chain acyl-CoA[c] '''+''' 1 H+[c] '''+''' 1 NADPH[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[Tiso_gene_16113]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[Tiso_gene_8272]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[Tiso_gene_7447]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[Tiso_gene_883]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[Tiso_gene_6295]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[Tiso_gene_14511]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[Tiso_gene_6475]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[Tiso_gene_10643]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * [[orthology]]: | ||
+ | ** [[pantograph]]: | ||
+ | *** [[esiliculosus]] | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-RXN: |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R02620 R02620] |
− | * | + | * UNIPROT: |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q7M1E9 Q7M1E9] |
− | + | {{#set: direction=REVERSIBLE}} | |
− | + | {{#set: ec number=EC-1.2.1.50}} | |
− | {{#set: | + | {{#set: gene associated=Tiso_gene_16113|Tiso_gene_8272|Tiso_gene_7447|Tiso_gene_883|Tiso_gene_6295|Tiso_gene_14511|Tiso_gene_6475|Tiso_gene_10643}} |
− | {{#set: | + | {{#set: in pathway=}} |
− | {{#set: | + | {{#set: reconstruction category=orthology}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
− | {{#set: | + | {{#set: reconstruction source=esiliculosus}} |
− | {{#set: | + |
Revision as of 17:11, 10 January 2018
Contents
Reaction LONG-CHAIN-FATTY-ACYL-COA-REDUCTASE-RXN
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 NADP[c] + 1 Long-Chain-Aldehydes[c] + 1 CO-A[c] <=> 1 Long-Chain-Acyl-CoAs[c] + 1 PROTON[c] + 1 NADPH[c]
- With common name(s):
- 1 NADP+[c] + 1 a long-chain aldehyde[c] + 1 coenzyme A[c] <=> 1 a long-chain acyl-CoA[c] + 1 H+[c] + 1 NADPH[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Tiso_gene_16113
- Tiso_gene_8272
- Tiso_gene_7447
- Tiso_gene_883
- Tiso_gene_6295
- Tiso_gene_14511
- Tiso_gene_6475
- Tiso_gene_10643
Pathways
Reconstruction information
External links