Difference between revisions of "5-AMINO-LEVULINATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14927 CPD-14927] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(=O)[O-] * inchi key: ** InCh...")
 
(Created page with "Category:Gene == Gene Tiso_gene_4228 == * Synonym(s): == Reactions associated == * GLYOXIII-RXN ** pantograph-esiliculosus == Pathways associated == == Extern...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14927 CPD-14927] ==
+
== Gene Tiso_gene_4228 ==
* smiles:
+
** CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(=O)[O-]
+
* inchi key:
+
** InChIKey=WDWBNNBRPVEEOD-PFXVRADUSA-M
+
* common name:
+
** phytenate
+
* molecular weight:
+
** 309.511   
+
 
* Synonym(s):
 
* Synonym(s):
** 2E-phytenate
 
** 2E-phytenic acid
 
** 3,7,11,15-tetramethyl-2E-hexadecenoic acid
 
** (E)-3,7,11,15-tetramethylhexadec-2-enoic acid
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN66-480]]
+
* [[GLYOXIII-RXN]]
== Reaction(s) known to produce the compound ==
+
** [[pantograph]]-[[esiliculosus]]
* [[RXN66-479]]
+
== Pathways associated ==
== Reaction(s) of unknown directionality ==
+
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMPR0104010024
+
{{#set: reaction associated=GLYOXIII-RXN}}
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=40561589 40561589]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.4471755.html 4471755]
+
{{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(=O)[O-]}}
+
{{#set: inchi key=InChIKey=WDWBNNBRPVEEOD-PFXVRADUSA-M}}
+
{{#set: common name=phytenate}}
+
{{#set: molecular weight=309.511    }}
+
{{#set: common name=2E-phytenate|2E-phytenic acid|3,7,11,15-tetramethyl-2E-hexadecenoic acid|(E)-3,7,11,15-tetramethylhexadec-2-enoic acid}}
+
{{#set: consumed by=RXN66-480}}
+
{{#set: produced by=RXN66-479}}
+

Revision as of 17:12, 10 January 2018

Gene Tiso_gene_4228

  • Synonym(s):

Reactions associated

Pathways associated

External links