Difference between revisions of "Tiso gene 500"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7367 CPD-7367] == * smiles: ** [CH](=O)C1(=CC=C(O)C(N)=C1) * inchi key: ** InChIKey=LMGGPKY...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6829 PWY-6829] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6829 PWY-6829] == |
− | * | + | * taxonomic range: |
− | ** [ | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** tRNA methylation (yeast) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | == Reaction(s) | + | * '''3''' reaction(s) found |
− | + | ** [[RXN-11856]] | |
− | * [[RXN- | + | ** [[RXN-12375]] |
+ | ** [[RXN-12376]] | ||
+ | == Reaction(s) not found == | ||
+ | * '''12''' reaction(s) not found | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-11868 RXN-11868] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-12374 RXN-12374] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-12466 RXN-12466] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-11859 RXN-11859] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-11858 RXN-11858] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-11857 RXN-11857] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-12478 RXN-12478] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-12479 RXN-12479] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-12368 RXN-12368] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-12477 RXN-12477] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-14517 RXN-14517] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-12461 RXN-12461] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2759}} | |
− | + | {{#set: common name=tRNA methylation (yeast)}} | |
− | + | {{#set: reaction found=3}} | |
− | + | {{#set: reaction not found=12}} | |
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 16:13, 10 January 2018
Pathway PWY-6829
- taxonomic range:
- common name:
- tRNA methylation (yeast)
- Synonym(s):
Reaction(s) found
Reaction(s) not found
- 12 reaction(s) not found