Difference between revisions of "CPD-6702"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLLIDE-A CHLOROPHYLLIDE-A] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8022 RXN-8022] == * direction: ** LEFT-TO-RIGHT * Synonym(s): ** Crtlb ** phytoene desaturase (...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLLIDE-A CHLOROPHYLLIDE-A] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8022 RXN-8022] ==
* smiles:
+
* direction:
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
** LEFT-TO-RIGHT
* common name:
+
** chlorophyllide a
+
* molecular weight:
+
** 612.967   
+
 
* Synonym(s):
 
* Synonym(s):
** chlorophyllide
+
** Crtlb
 +
** phytoene desaturase (ambiguous)
 +
** 2-step phytoene desaturase (ambiguous)
 +
** two-step phytoene desaturase (ambiguous)
 +
** CrtI (ambiguous)
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-7663]]
+
* With identifiers:
* [[RXN-7676]]
+
** 1 [[Acceptor]][c] '''+''' 1 [[CPD1F-98]][c] '''=>''' 1 [[Donor-H2]][c] '''+''' 1 [[NEUROSPORENE]][c]
* [[RXN-13398]]
+
* With common name(s):
== Reaction(s) known to produce the compound ==
+
** 1 an oxidized electron acceptor[c] '''+''' 1 all-trans-ζ-carotene[c] '''=>''' 1 a reduced electron acceptor[c] '''+''' 1 all-trans neurosporene[c]
* [[RXN-5286]]
+
 
== Reaction(s) of unknown directionality ==
+
== Genes associated with this reaction  ==
* [[RXN1F-10]]
+
Genes have been associated with this reaction based on different elements listed below.
* [[RXN1F-66]]
+
* [[Tiso_gene_7142]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-6287]], neurosporene biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6287 PWY-6287]
 +
** '''4''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[esiliculosus]]
 
== External links  ==
 
== External links  ==
* CAS : 14897-06-4
+
* RHEA:
* PUBCHEM:
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30614 30614]
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54729368 54729368]
+
* LIGAND-RXN:
* CHEBI:
+
** [http://www.genome.jp/dbget-bin/www_bget?R04798 R04798]
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83348 83348]
+
{{#set: direction=LEFT-TO-RIGHT}}
* LIGAND-CPD:
+
{{#set: common name=Crtlb|phytoene desaturase (ambiguous)|2-step phytoene desaturase (ambiguous)|two-step phytoene desaturase (ambiguous)|CrtI (ambiguous)}}
** [http://www.genome.jp/dbget-bin/www_bget?C02139 C02139]
+
{{#set: gene associated=Tiso_gene_7142}}
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
{{#set: in pathway=PWY-6287}}
{{#set: common name=chlorophyllide a}}
+
{{#set: reconstruction category=orthology}}
{{#set: molecular weight=612.967    }}
+
{{#set: reconstruction tool=pantograph}}
{{#set: common name=chlorophyllide}}
+
{{#set: reconstruction source=esiliculosus}}
{{#set: consumed by=RXN-7663|RXN-7676|RXN-13398}}
+
{{#set: produced by=RXN-5286}}
+
{{#set: consumed or produced by=RXN1F-10|RXN1F-66}}
+

Revision as of 16:14, 10 January 2018

Reaction RXN-8022

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):
    • Crtlb
    • phytoene desaturase (ambiguous)
    • 2-step phytoene desaturase (ambiguous)
    • two-step phytoene desaturase (ambiguous)
    • CrtI (ambiguous)

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 an oxidized electron acceptor[c] + 1 all-trans-ζ-carotene[c] => 1 a reduced electron acceptor[c] + 1 all-trans neurosporene[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6287, neurosporene biosynthesis: PWY-6287
    • 4 reactions found over 5 reactions in the full pathway

Reconstruction information

External links