Difference between revisions of "Tiso gene 8689"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=CITRULLINE-DEG-PWY CITRULLINE-DEG-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?ob...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6702 CPD-6702] == * smiles: ** C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1) * inchi key: **...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=CITRULLINE-DEG-PWY CITRULLINE-DEG-PWY] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6702 CPD-6702] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
+
** C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1)
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
+
* inchi key:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** InChIKey=INAPMGSXUVUWAF-XCMZKKERSA-L
 
* common name:
 
* common name:
−
** L-citrulline degradation
+
** 1D-myo-inositol 6-monophosphate
 +
* molecular weight:
 +
** 258.121   
 
* Synonym(s):
 
* Synonym(s):
 +
** Ins(6)P1
 +
** 1D-myo-inositol 6-phosphate
 +
** Ins(6)P
 +
** Ins6P
 +
** D-myo-inositol 6-monophosphate
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
* '''2''' reaction(s) found
+
* [[RXN-10954]]
−
** [[ORNCARBAMTRANSFER-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** [[CARBAMATE-KINASE-RXN]]
+
== Reaction(s) of unknown directionality ==
−
== Reaction(s) not found ==
+
−
* '''0''' reaction(s) not found
+
 
== External links  ==
 
== External links  ==
−
* ARACYC:
+
* PUBCHEM:
−
** [http://metacyc.org/ARA/NEW-IMAGE?object=CITRULLINE-DEG-PWY CITRULLINE-DEG-PWY]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203035 25203035]
−
{{#set: taxonomic range=TAX-2157}}
+
* CHEBI:
−
{{#set: taxonomic range=TAX-2759}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64841 64841]
−
{{#set: taxonomic range=TAX-2}}
+
{{#set: smiles=C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1)}}
−
{{#set: common name=L-citrulline degradation}}
+
{{#set: inchi key=InChIKey=INAPMGSXUVUWAF-XCMZKKERSA-L}}
−
{{#set: reaction found=2}}
+
{{#set: common name=1D-myo-inositol 6-monophosphate}}
−
{{#set: reaction not found=0}}
+
{{#set: molecular weight=258.121    }}
 +
{{#set: common name=Ins(6)P1|1D-myo-inositol 6-phosphate|Ins(6)P|Ins6P|D-myo-inositol 6-monophosphate}}
 +
{{#set: consumed by=RXN-10954}}

Revision as of 16:15, 10 January 2018

Metabolite CPD-6702

  • smiles:
    • C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1)
  • inchi key:
    • InChIKey=INAPMGSXUVUWAF-XCMZKKERSA-L
  • common name:
    • 1D-myo-inositol 6-monophosphate
  • molecular weight:
    • 258.121
  • Synonym(s):
    • Ins(6)P1
    • 1D-myo-inositol 6-phosphate
    • Ins(6)P
    • Ins6P
    • D-myo-inositol 6-monophosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_8689&oldid=12130"