Difference between revisions of "DCDP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15361 CPD-15361] == * smiles: ** CCCCCCCCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)CO...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13908 RXN-13908] == * direction: ** LEFT-TO-RIGHT * common name: ** transcriptional_coactivator...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15361 CPD-15361] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13908 RXN-13908] ==
−
* smiles:
+
* direction:
−
** CCCCCCCCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=PREOMQKNJXWCLZ-ZHLMIUQRSA-J
+
 
* common name:
 
* common name:
−
** 3R-hydroxy-(11Z)-eicos-11-enoyl-CoA
+
** transcriptional_coactivator_pterin_dehydratase
−
* molecular weight:
+
* ec number:
−
** 1072.006   
+
** [http://enzyme.expasy.org/EC/4.2.1.96 EC-4.2.1.96]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-14484]]
+
** 1 [[CPD-14931]][c] '''=>''' 1 [[10-FORMYL-DIHYDROFOLATE-GLU-N]][c] '''+''' 1 [[WATER]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a 10-formyltetrahydrofolate-4a-carbinolamine[c] '''=>''' 1 an N10-formyldihydrofolate[c] '''+''' 1 H2O[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_14844]]
 +
** IN-SILICO_ANNOTATION
 +
***EC-NUMBER
 +
* [[Tiso_gene_14845]]
 +
** IN-SILICO_ANNOTATION
 +
***EC-NUMBER
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-7158]], L-phenylalanine degradation V: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7158 PWY-7158]
 +
** '''1''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[esiliculosus]]
 +
* [[annotation]]:
 +
** [[pathwaytools]]:
 +
*** [[in-silico_annotation]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193763 72193763]
+
{{#set: common name=transcriptional_coactivator_pterin_dehydratase}}
−
* CHEBI:
+
{{#set: ec number=EC-4.2.1.96}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76387 76387]
+
{{#set: gene associated=Tiso_gene_14844|Tiso_gene_14845}}
−
{{#set: smiles=CCCCCCCCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: in pathway=PWY-7158}}
−
{{#set: inchi key=InChIKey=PREOMQKNJXWCLZ-ZHLMIUQRSA-J}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: common name=3R-hydroxy-(11Z)-eicos-11-enoyl-CoA}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: molecular weight=1072.006    }}
+
{{#set: reconstruction source=esiliculosus}}
−
{{#set: produced by=RXN-14484}}
+
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction tool=pathwaytools}}
 +
{{#set: reconstruction source=in-silico_annotation}}

Revision as of 17:15, 10 January 2018

Reaction RXN-13908

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • transcriptional_coactivator_pterin_dehydratase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7158, L-phenylalanine degradation V: PWY-7158
    • 1 reactions found over 3 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=DCDP&oldid=12153"