Difference between revisions of "RXN-11921"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16001 CPD-16001] == * smiles: ** CCCCC=CCCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15361 CPD-15361] == * smiles: ** CCCCCCCCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)CO...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15361 CPD-15361] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CCCCCCCCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=PREOMQKNJXWCLZ-ZHLMIUQRSA-J |
* common name: | * common name: | ||
| − | ** (11Z)- | + | ** 3R-hydroxy-(11Z)-eicos-11-enoyl-CoA |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 1072.006 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-14484]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193763 72193763] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76387 76387] |
| − | {{#set: smiles= | + | {{#set: smiles=CCCCCCCCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=PREOMQKNJXWCLZ-ZHLMIUQRSA-J}} |
| − | {{#set: common name=(11Z)- | + | {{#set: common name=3R-hydroxy-(11Z)-eicos-11-enoyl-CoA}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=1072.006 }} |
| − | {{#set: | + | {{#set: produced by=RXN-14484}} |
| − | + | ||
Revision as of 16:17, 10 January 2018
Contents
Metabolite CPD-15361
- smiles:
- CCCCCCCCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=PREOMQKNJXWCLZ-ZHLMIUQRSA-J
- common name:
- 3R-hydroxy-(11Z)-eicos-11-enoyl-CoA
- molecular weight:
- 1072.006
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
