Difference between revisions of "EPOXYSQUALENE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-690 CPD-690] == * smiles: ** CC5(=C%10(C(C)(CCC([O-])=O)C(CC(=O)[O-])C9(C%11(C)(C(C)(CC(N)=...")
 
(Created page with "Category:Gene == Gene Tiso_gene_3052 == * left end position: ** 9007 * transcription direction: ** POSITIVE * right end position: ** 12016 * centisome position: ** 51.0427...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-690 CPD-690] ==
+
== Gene Tiso_gene_3052 ==
−
* smiles:
+
* left end position:
−
** CC5(=C%10(C(C)(CCC([O-])=O)C(CC(=O)[O-])C9(C%11(C)(C(C)(CC(N)=O)C(CCC([O-])=O)C1(=[N+]([Co--]3([N+]2(C(=C(C)1)C(C)(CC(N)=O)C(CCC([O-])=O)C=2C=C4(C(C)(C)C(CCC([O-])=O)C(=[N+]34)5)))(CC6(C(C(O)C(O6)N7(C=NC8(=C7N=CN=C8N)))O))N9%10)%11)))))
+
** 9007
−
* inchi key:
+
* transcription direction:
−
** InChIKey=OCNLJCZKGHKJGF-NQYRMHKHSA-H
+
** POSITIVE
−
* common name:
+
* right end position:
−
** adenosyl-cobyrinate a,c-diamide
+
** 12016
−
* molecular weight:
+
* centisome position:
−
** 1182.137    
+
** 51.04273    
 
* Synonym(s):
 
* Synonym(s):
−
** adenosyl-cobyrinic acid a,c-diamide
 
−
** Adenosyl cobyrinate diamide
 
−
** Adenosylcob(III)yrinic acid a,c-diamide
 
−
** Adenosylcobyrinic acid a,c-diamide
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[3.1.3.66-RXN]]
−
* [[R344-RXN]]
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
* [[RXN-10959]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN-10960]]
 +
** in-silico_annotation
 +
***ec-number
 +
== Pathways associated ==
 +
* [[PWY-6368]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=9007}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819815 91819815]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=12016}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58503 58503]
+
{{#set: centisome position=51.04273   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=3.1.3.66-RXN|RXN-10959|RXN-10960}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06506 C06506]
+
{{#set: pathway associated=PWY-6368}}
−
* HMDB : HMDB01083
+
−
{{#set: smiles=CC5(=C%10(C(C)(CCC([O-])=O)C(CC(=O)[O-])C9(C%11(C)(C(C)(CC(N)=O)C(CCC([O-])=O)C1(=[N+]([Co--]3([N+]2(C(=C(C)1)C(C)(CC(N)=O)C(CCC([O-])=O)C=2C=C4(C(C)(C)C(CCC([O-])=O)C(=[N+]34)5)))(CC6(C(C(O)C(O6)N7(C=NC8(=C7N=CN=C8N)))O))N9%10)%11)))))}}
+
−
{{#set: inchi key=InChIKey=OCNLJCZKGHKJGF-NQYRMHKHSA-H}}
+
−
{{#set: common name=adenosyl-cobyrinate a,c-diamide}}
+
−
{{#set: molecular weight=1182.137   }}
+
−
{{#set: common name=adenosyl-cobyrinic acid a,c-diamide|Adenosyl cobyrinate diamide|Adenosylcob(III)yrinic acid a,c-diamide|Adenosylcobyrinic acid a,c-diamide}}
+
−
{{#set: produced by=R344-RXN}}
+

Revision as of 17:17, 10 January 2018

Gene Tiso_gene_3052

  • left end position:
    • 9007
  • transcription direction:
    • POSITIVE
  • right end position:
    • 12016
  • centisome position:
    • 51.04273
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=EPOXYSQUALENE&oldid=12277"