Difference between revisions of "XYLITOL"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HCN HCN] == * smiles: ** C#N * inchi key: ** InChIKey=LELOWRISYMNNSU-UHFFFAOYSA-N * common name...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-207 CPD-207] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC1(C=CC=CC=1))COP(=O)(OP(=O)(...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-207 CPD-207] == |
* smiles: | * smiles: | ||
| − | ** C | + | ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC1(C=CC=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=ZIGIFDRJFZYEEQ-CECATXLMSA-J |
* common name: | * common name: | ||
| − | ** | + | ** phenylacetyl-CoA |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 881.637 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** phenylacetate-CoA |
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-10821]] |
| − | + | ||
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | * | + | * BIGG : phaccoa |
| − | + | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266611 45266611] |
| − | * HMDB : | + | * HMDB : HMDB06503 |
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00582 C00582] |
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57390 57390] |
| − | * | + | * METABOLIGHTS : MTBLC57390 |
| − | {{#set: smiles=C | + | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC1(C=CC=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=ZIGIFDRJFZYEEQ-CECATXLMSA-J}} |
| − | {{#set: common name= | + | {{#set: common name=phenylacetyl-CoA}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=881.637 }} |
| − | {{#set: common name= | + | {{#set: common name=phenylacetate-CoA}} |
| − | + | {{#set: consumed by=RXN-10821}} | |
| − | {{#set: | + | |
Revision as of 17:18, 10 January 2018
Contents
Metabolite CPD-207
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC1(C=CC=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
- inchi key:
- InChIKey=ZIGIFDRJFZYEEQ-CECATXLMSA-J
- common name:
- phenylacetyl-CoA
- molecular weight:
- 881.637
- Synonym(s):
- phenylacetate-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : phaccoa
- PUBCHEM:
- HMDB : HMDB06503
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC57390
"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC1(C=CC=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-" cannot be used as a page name in this wiki.
