Difference between revisions of "Tiso gene 19883"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6991 CPD-6991] == * smiles: ** C3(C=CC(C2(OC1(=CC(=CC(=C1C(C2)=O)O)[O-])))=CC=3) * inchi ke...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7782 PWY-7782] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-3...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7782 PWY-7782] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** plasmalogen biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | * '''7''' reaction(s) found |
− | == Reaction(s) | + | ** [[RXN-5641]] |
− | * [[RXN- | + | ** [[2.7.7.14-RXN]] |
− | == | + | ** [[RXN-17730]] |
+ | ** [[RXN-17731]] | ||
+ | ** [[RXN-17729]] | ||
+ | ** [[ETHANOLAMINE-KINASE-RXN]] | ||
+ | ** [[CHOLINE-KINASE-RXN]] | ||
+ | == Reaction(s) not found == | ||
+ | * '''9''' reaction(s) not found | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=2.7.7.15-RXN 2.7.7.15-RXN] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=2.7.8.22-RXN 2.7.8.22-RXN] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.42-RXN 2.3.1.42-RXN] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-17734 RXN-17734] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-9344 RXN-9344] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-17732 RXN-17732] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-17733 RXN-17733] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=ALKYLGLYCERONE-PHOSPHATE-SYNTHASE-RXN ALKYLGLYCERONE-PHOSPHATE-SYNTHASE-RXN] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-17728 RXN-17728] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-33208}} | |
− | + | {{#set: common name=plasmalogen biosynthesis}} | |
− | + | {{#set: reaction found=7}} | |
− | + | {{#set: reaction not found=9}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 16:20, 10 January 2018
Pathway PWY-7782
- taxonomic range:
- common name:
- plasmalogen biosynthesis
- Synonym(s):
Reaction(s) found
- 7 reaction(s) found
Reaction(s) not found
- 9 reaction(s) not found