Difference between revisions of "Tiso gene 1791"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSINE ADENOSINE] == * smiles: ** C(O)C1(OC(C(O)C(O)1)N3(C=NC2(C(N)=NC=NC=23))) * inchi key:...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSYLCOBINAMIDE ADENOSYLCOBINAMIDE] == * smiles: ** C[CH](CNC(CCC4(C8(N3([Co--]17([N+]5(C(=C...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSYLCOBINAMIDE ADENOSYLCOBINAMIDE] == |
* smiles: | * smiles: | ||
− | ** C(O) | + | ** C[CH](CNC(CCC4(C8(N3([Co--]17([N+]5(C(=C(C)C2(=[N+]1C(C(C2CCC(N)=O)(CC(=O)N)C)(C)[CH]3C(CC(=O)N)4))C(C(CCC(=O)N)C=5C=C6(C(C)(C)C(CCC(=O)N)C(=[N+]67)C=8C))(CC(=O)N)C))CC9(OC(C(O)C(O)9)N%11(C=NC%10(=C(N)N=CN=C%10%11))))))C)=O)O |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=KQXSPGAEBZWHMC-VUCSARQQSA-M |
* common name: | * common name: | ||
− | ** | + | ** adenosylcobinamide |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 1240.332 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** AdoCbi |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[BTUR2-RXN]] |
− | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06508 C06508] |
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=2480 2480] |
− | * BIGG : | + | * BIGG : adocbi |
− | {{#set: smiles=C(O) | + | * PUBCHEM: |
− | {{#set: inchi key=InChIKey= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819767 91819767] |
− | {{#set: common name= | + | * HMDB : HMDB06903 |
− | {{#set: molecular weight= | + | {{#set: smiles=C[CH](CNC(CCC4(C8(N3([Co--]17([N+]5(C(=C(C)C2(=[N+]1C(C(C2CCC(N)=O)(CC(=O)N)C)(C)[CH]3C(CC(=O)N)4))C(C(CCC(=O)N)C=5C=C6(C(C)(C)C(CCC(=O)N)C(=[N+]67)C=8C))(CC(=O)N)C))CC9(OC(C(O)C(O)9)N%11(C=NC%10(=C(N)N=CN=C%10%11))))))C)=O)O}} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=KQXSPGAEBZWHMC-VUCSARQQSA-M}} |
− | + | {{#set: common name=adenosylcobinamide}} | |
− | + | {{#set: molecular weight=1240.332 }} | |
− | {{#set: | + | {{#set: common name=AdoCbi}} |
+ | {{#set: produced by=BTUR2-RXN}} |
Revision as of 16:21, 10 January 2018
Contents
Metabolite ADENOSYLCOBINAMIDE
- smiles:
- C[CH](CNC(CCC4(C8(N3([Co--]17([N+]5(C(=C(C)C2(=[N+]1C(C(C2CCC(N)=O)(CC(=O)N)C)(C)[CH]3C(CC(=O)N)4))C(C(CCC(=O)N)C=5C=C6(C(C)(C)C(CCC(=O)N)C(=[N+]67)C=8C))(CC(=O)N)C))CC9(OC(C(O)C(O)9)N%11(C=NC%10(=C(N)N=CN=C%10%11))))))C)=O)O
- inchi key:
- InChIKey=KQXSPGAEBZWHMC-VUCSARQQSA-M
- common name:
- adenosylcobinamide
- molecular weight:
- 1240.332
- Synonym(s):
- AdoCbi
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C[CH](CNC(CCC4(C8(N3([Co--]17([N+]5(C(=C(C)C2(=[N+]1C(C(C2CCC(N)=O)(CC(=O)N)C)(C)[CH]3C(CC(=O)N)4))C(C(CCC(=O)N)C=5C=C6(C(C)(C)C(CCC(=O)N)C(=[N+]67)C=8C))(CC(=O)N)C))CC9(OC(C(O)C(O)9)N%11(C=NC%10(=C(N)N=CN=C%10%11))))))C)=O)O" cannot be used as a page name in this wiki.