Difference between revisions of "TransportSeed OXYGEN-MOLECULE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLEYL-CPD INDOLEYL-CPD] == * smiles: ** C2(NC1(C=CC=CC=1C(CC#N)=2)) * inchi key: ** InChIKey...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5141 RXN0-5141] == * direction: ** LEFT-TO-RIGHT * common name: ** probable_voltage-gated_pota...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5141 RXN0-5141] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** probable_voltage-gated_potassium_channel_subunit_beta |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.1.1.91 EC-1.1.1.91] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[CPD-703]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[CPD-702]][c] |
− | == | + | * With common name(s): |
− | == | + | ** 1 4-nitrobenzaldehyde[c] '''+''' 1 NADPH[c] '''+''' 1 H+[c] '''=>''' 1 NADP+[c] '''+''' 1 4-nitrobenzyl alcohol[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[Tiso_gene_8612]] | ||
+ | ** IN-SILICO_ANNOTATION | ||
+ | ***EC-NUMBER | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * [[annotation]]: | ||
+ | ** [[pathwaytools]]: | ||
+ | *** [[in-silico_annotation]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=probable_voltage-gated_potassium_channel_subunit_beta}} | |
− | + | {{#set: ec number=EC-1.1.1.91}} | |
− | + | {{#set: gene associated=Tiso_gene_8612}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | {{#set: reconstruction source=in-silico_annotation}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 16:23, 10 January 2018
Contents
Reaction RXN0-5141
- direction:
- LEFT-TO-RIGHT
- common name:
- probable_voltage-gated_potassium_channel_subunit_beta
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 4-nitrobenzaldehyde[c] + 1 NADPH[c] + 1 H+[c] => 1 NADP+[c] + 1 4-nitrobenzyl alcohol[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Tiso_gene_8612
- IN-SILICO_ANNOTATION
- EC-NUMBER
- IN-SILICO_ANNOTATION