Difference between revisions of "PWY4FS-11"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12160 CPD-12160] == * common name: ** 24-alkyl sterol 1 * Synonym(s): == Reaction(s) known...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15374 CPD-15374] == * smiles: ** [CH](=O)C(C(C(C(CO)O)O)O)O * inchi key: ** InChIKey=GZCGUP...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12160 CPD-12160] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15374 CPD-15374] ==
 +
* smiles:
 +
** [CH](=O)C(C(C(C(CO)O)O)O)O
 +
* inchi key:
 +
** InChIKey=GZCGUPFRVQAUEE-SLPGGIOYSA-N
 
* common name:
 
* common name:
** 24-alkyl sterol 1
+
** aldehydo-D-glucose
 +
* molecular weight:
 +
** 180.157   
 
* Synonym(s):
 
* Synonym(s):
 +
** (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal
 +
** linear D-glucose
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-14408]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11201]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=24-alkyl sterol 1}}
+
* PUBCHEM:
{{#set: produced by=RXN-11201}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=107526 107526]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=42758 42758]
 +
{{#set: smiles=[CH](=O)C(C(C(C(CO)O)O)O)O}}
 +
{{#set: inchi key=InChIKey=GZCGUPFRVQAUEE-SLPGGIOYSA-N}}
 +
{{#set: common name=aldehydo-D-glucose}}
 +
{{#set: molecular weight=180.157    }}
 +
{{#set: common name=(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal|linear D-glucose}}
 +
{{#set: consumed by=RXN-14408}}

Revision as of 17:24, 10 January 2018

Metabolite CPD-15374

  • smiles:
    • [CH](=O)C(C(C(C(CO)O)O)O)O
  • inchi key:
    • InChIKey=GZCGUPFRVQAUEE-SLPGGIOYSA-N
  • common name:
    • aldehydo-D-glucose
  • molecular weight:
    • 180.157
  • Synonym(s):
    • (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal
    • linear D-glucose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CH](=O)C(C(C(C(CO)O)O)O)O" cannot be used as a page name in this wiki.