Difference between revisions of "PYRIDOXINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8355 CPD-8355] == * smiles: ** CCCCCCCCC=CCCCCCCCC(OCC(O)COP([O-])(=O)OCC[N+])=O * inchi ke...") |
(Created page with "Category:Gene == Gene Tiso_gene_15743 == * left end position: ** 756 * transcription direction: ** NEGATIVE * right end position: ** 4752 * centisome position: ** 15.66514...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_15743 == |
− | * | + | * left end position: |
− | ** | + | ** 756 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 4752 |
− | * | + | * centisome position: |
− | ** | + | ** 15.665147 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * [[RXN-11370]] |
− | + | ** in-silico_annotation | |
− | * [[RXN- | + | ***ec-number |
− | == | + | ** [[pantograph]]-[[esiliculosus]] |
− | * [[ | + | * [[RXN-11373]] |
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-11374]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-14326]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6482]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=756}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=4752}} | |
− | + | {{#set: centisome position=15.665147 }} | |
− | + | {{#set: reaction associated=RXN-11370|RXN-11373|RXN-11374|RXN-14326}} | |
− | {{#set: | + | {{#set: pathway associated=PWY-6482}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | {{#set: | + |
Revision as of 17:26, 10 January 2018
Gene Tiso_gene_15743
- left end position:
- 756
- transcription direction:
- NEGATIVE
- right end position:
- 4752
- centisome position:
- 15.665147
- Synonym(s):
Reactions associated
- RXN-11370
- in-silico_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation
- RXN-11373
- in-silico_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation
- RXN-11374
- in-silico_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation
- RXN-14326
- in-silico_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation