Difference between revisions of "Tiso gene 19075"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15687 CPD-15687] == * smiles: ** CCCCCCC=CC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O...")
 
(Created page with "Category:Gene == Gene Tiso_gene_9520 == * Synonym(s): == Reactions associated == * RXN-15556 ** pantograph-esiliculosus == Pathways associated == * PWY-7511...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15687 CPD-15687] ==
+
== Gene Tiso_gene_9520 ==
* smiles:
+
** CCCCCCC=CC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=NJXBFCFHVUIEMZ-QTJPLKLFSA-J
+
* common name:
+
** 5-cis, 7-trans-3-oxo-tetradecadienoyl-CoA
+
* molecular weight:
+
** 983.813   
+
 
* Synonym(s):
 
* Synonym(s):
** 5Z, 7E-3-oxo-tetradecadienoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-14799]]
+
* [[RXN-15556]]
== Reaction(s) known to produce the compound ==
+
** [[pantograph]]-[[esiliculosus]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-7511]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=RXN-15556}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657719 90657719]
+
{{#set: pathway associated=PWY-7511}}
{{#set: smiles=CCCCCCC=CC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=NJXBFCFHVUIEMZ-QTJPLKLFSA-J}}
+
{{#set: common name=5-cis, 7-trans-3-oxo-tetradecadienoyl-CoA}}
+
{{#set: molecular weight=983.813    }}
+
{{#set: common name=5Z, 7E-3-oxo-tetradecadienoyl-CoA}}
+
{{#set: consumed by=RXN-14799}}
+

Revision as of 16:28, 10 January 2018

Gene Tiso_gene_9520

  • Synonym(s):

Reactions associated

Pathways associated

External links