Difference between revisions of "AMP5N"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15526 CPD-15526] == * smiles: ** CC23(C1(C(C(=O)NC(=O)N1)(C)C(NCNC(=O)2)3)) * inchi key: **...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-delta21-3-oxo-C40-ACPs cis-delta21-3-oxo-C40-ACPs] == * common name: ** a cis-delta21-3-oxo...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15526 CPD-15526] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-delta21-3-oxo-C40-ACPs cis-delta21-3-oxo-C40-ACPs] ==
* smiles:
+
** CC23(C1(C(C(=O)NC(=O)N1)(C)C(NCNC(=O)2)3))
+
* inchi key:
+
** InChIKey=FUVBFHHFGQNFFS-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** cyclobutadipyrimidine
+
** a cis-delta21-3-oxo-C40:1-[acp]
* molecular weight:
+
** 238.246   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN1G-287]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.2.2.17-RXN]]
+
* [[RXN1G-132]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a cis-delta21-3-oxo-C40:1-[acp]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659235 90659235]
+
{{#set: consumed by=RXN1G-287}}
* CHEBI:
+
{{#set: produced by=RXN1G-132}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=38923 38923]
+
{{#set: smiles=CC23(C1(C(C(=O)NC(=O)N1)(C)C(NCNC(=O)2)3))}}
+
{{#set: inchi key=InChIKey=FUVBFHHFGQNFFS-UHFFFAOYSA-N}}
+
{{#set: common name=cyclobutadipyrimidine}}
+
{{#set: molecular weight=238.246    }}
+
{{#set: produced by=3.2.2.17-RXN}}
+

Revision as of 16:31, 10 January 2018

Metabolite cis-delta21-3-oxo-C40-ACPs

  • common name:
    • a cis-delta21-3-oxo-C40:1-[acp]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a cis-delta21-3-oxo-C40:1-[acp" cannot be used as a page name in this wiki.