Difference between revisions of "GLYCOLATE-REDUCTASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=AMP5N AMP5N] == * direction: ** LEFT-TO-RIGHT * common name: ** AMP-5'-nucleotidase * Synonym(s):...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8609 CPD-8609] == * smiles: ** CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=AMP5N AMP5N] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8609 CPD-8609] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))=CC4)))C
 +
* inchi key:
 +
** InChIKey=OGQJUYXFIOFTMA-PBJLWWPKSA-N
 
* common name:
 
* common name:
−
** AMP-5'-nucleotidase
+
** 4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol
 +
* molecular weight:
 +
** 412.698   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN66-14]]
−
** 1.0 [[AMP]][c] '''+''' 1.0 [[WATER]][c] '''=>''' 1.0 [[ADENOSINE]][c] '''+''' 1.0 [[Pi]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN66-13]]
−
** 1.0 AMP[c] '''+''' 1.0 H2O[c] '''=>''' 1.0 adenosine[c] '''+''' 1.0 phosphate[c]
+
* [[RXN-13707]]
−
 
+
== Reaction(s) of unknown directionality ==
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_6988]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
* [[Tiso_gene_9166]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=AMP-5'-nucleotidase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=167817 167817]
−
{{#set: gene associated=Tiso_gene_6988|Tiso_gene_9166}}
+
* CHEBI:
−
{{#set: in pathway=}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=78904 78904]
−
{{#set: reconstruction category=orthology}}
+
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))=CC4)))C}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: inchi key=InChIKey=OGQJUYXFIOFTMA-PBJLWWPKSA-N}}
−
{{#set: reconstruction source=creinhardtii}}
+
{{#set: common name=4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol}}
 +
{{#set: molecular weight=412.698    }}
 +
{{#set: consumed by=RXN66-14}}
 +
{{#set: produced by=RXN66-13|RXN-13707}}

Revision as of 16:31, 10 January 2018

Metabolite CPD-8609

  • smiles:
    • CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))=CC4)))C
  • inchi key:
    • InChIKey=OGQJUYXFIOFTMA-PBJLWWPKSA-N
  • common name:
    • 4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol
  • molecular weight:
    • 412.698
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))=CC4)))C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=GLYCOLATE-REDUCTASE-RXN&oldid=13348"