Difference between revisions of "Tiso gene 7745"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYURIDINE DEOXYURIDINE] == * smiles: ** C1(=CN(C(=O)NC(=O)1)C2(CC(O)C(CO)O2)) * inchi key: *...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9544 RXN-9544] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxo-stearoyl-CoA-reductase...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYURIDINE DEOXYURIDINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9544 RXN-9544] ==
−
* smiles:
+
* direction:
−
** C1(=CN(C(=O)NC(=O)1)C2(CC(O)C(CO)O2))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=MXHRCPNRJAMMIM-SHYZEUOFSA-N
+
 
* common name:
 
* common name:
−
** 2'-deoxyuridine
+
** 3-oxo-stearoyl-CoA-reductase
−
* molecular weight:
+
* ec number:
−
** 228.204   
+
** [http://enzyme.expasy.org/EC/1.1.1 EC-1.1.1]
 
* Synonym(s):
 
* Synonym(s):
−
** deoxyuridine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-14143]]
+
** 1 [[NADPH]][c] '''+''' 1 [[CPD-10260]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[CPD-10261]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[URA-PHOSPH-RXN]]
+
** 1 NADPH[c] '''+''' 1 3-oxo-stearoyl-CoA[c] '''+''' 1 H+[c] '''=>''' 1 NADP+[c] '''+''' 1 (3R)-3-hydroxy-stearoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_13083]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[Tiso_gene_8022]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-5972]], stearate biosynthesis I (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5972 PWY-5972]
 +
** '''4''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[esiliculosus]]
 +
* [[annotation]]:
 +
** [[pathwaytools]]:
 +
*** [[in-silico_annotation]]
 
== External links  ==
 
== External links  ==
−
* CAS : 951-78-0
+
* LIGAND-RXN:
−
* METABOLIGHTS : MTBLC16450
+
** [http://www.genome.jp/dbget-bin/www_bget?R07759 R07759]
−
* DRUGBANK : DB02256
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=3-oxo-stearoyl-CoA-reductase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=13712 13712]
+
{{#set: ec number=EC-1.1.1}}
−
* HMDB : HMDB00012
+
{{#set: gene associated=Tiso_gene_13083|Tiso_gene_8022}}
−
* LIGAND-CPD:
+
{{#set: in pathway=PWY-5972}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00526 C00526]
+
{{#set: reconstruction category=orthology}}
−
* CHEMSPIDER:
+
{{#set: reconstruction tool=pantograph}}
−
** [http://www.chemspider.com/Chemical-Structure.13118.html 13118]
+
{{#set: reconstruction source=esiliculosus}}
−
* CHEBI:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16450 16450]
+
{{#set: reconstruction tool=pathwaytools}}
−
* BIGG : duri
+
{{#set: reconstruction source=in-silico_annotation}}
−
{{#set: smiles=C1(=CN(C(=O)NC(=O)1)C2(CC(O)C(CO)O2))}}
+
−
{{#set: inchi key=InChIKey=MXHRCPNRJAMMIM-SHYZEUOFSA-N}}
+
−
{{#set: common name=2'-deoxyuridine}}
+
−
{{#set: molecular weight=228.204    }}
+
−
{{#set: common name=deoxyuridine}}
+
−
{{#set: produced by=RXN-14143}}
+
−
{{#set: consumed or produced by=URA-PHOSPH-RXN}}
+

Revision as of 17:32, 10 January 2018

Reaction RXN-9544

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-oxo-stearoyl-CoA-reductase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 NADPH[c] + 1 3-oxo-stearoyl-CoA[c] + 1 H+[c] => 1 NADP+[c] + 1 (3R)-3-hydroxy-stearoyl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5972, stearate biosynthesis I (animals and fungi): PWY-5972
    • 4 reactions found over 6 reactions in the full pathway

Reconstruction information

External links






Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_7745&oldid=13441"