Difference between revisions of "3.2.1.18-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7378 PWY-7378] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15530 CPD-15530] == * smiles: ** [CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-] * inchi key: ** InChIKey...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7378 PWY-7378] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15530 CPD-15530] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** [CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-]
 +
* inchi key:
 +
** InChIKey=IAJILQKETJEXLJ-QTBDOELSSA-M
 
* common name:
 
* common name:
−
** aminopropanol phosphate biosynthesis II
+
** aldehydo-D-glucuronate
 +
* molecular weight:
 +
** 193.133   
 
* Synonym(s):
 
* Synonym(s):
−
** (R)-1-amino-2-propanol O-2-phosphate biosynthesis II
+
** aldehydo-D-glucuronic acid
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
* '''2''' reaction(s) found
+
== Reaction(s) known to produce the compound ==
−
** [[THREODEHYD-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** [[THREOSPON-RXN]]
+
* [[RXN-14693]]
−
== Reaction(s) not found ==
+
* [[GLUCUROISOM-RXN]]
−
* '''2''' reaction(s) not found
+
−
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-8627 RXN-8627]
+
−
** [http://metacyc.org/META/NEW-IMAGE?object=AMINOPROPDEHYDROG-RXN AMINOPROPDEHYDROG-RXN]
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-2}}
+
* PUBCHEM:
−
{{#set: common name=aminopropanol phosphate biosynthesis II}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460126 5460126]
−
{{#set: common name=(R)-1-amino-2-propanol O-2-phosphate biosynthesis II}}
+
* CHEBI:
−
{{#set: reaction found=2}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=47953 47953]
−
{{#set: reaction not found=2}}
+
{{#set: smiles=[CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-]}}
 +
{{#set: inchi key=InChIKey=IAJILQKETJEXLJ-QTBDOELSSA-M}}
 +
{{#set: common name=aldehydo-D-glucuronate}}
 +
{{#set: molecular weight=193.133    }}
 +
{{#set: common name=aldehydo-D-glucuronic acid}}
 +
{{#set: consumed or produced by=RXN-14693|GLUCUROISOM-RXN}}

Revision as of 17:34, 10 January 2018

Metabolite CPD-15530

  • smiles:
    • [CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-]
  • inchi key:
    • InChIKey=IAJILQKETJEXLJ-QTBDOELSSA-M
  • common name:
    • aldehydo-D-glucuronate
  • molecular weight:
    • 193.133
  • Synonym(s):
    • aldehydo-D-glucuronic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=3.2.1.18-RXN&oldid=13578"