Difference between revisions of "Cis-delta13-3-hydroxylacceroyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-FORMYL-THF 5-FORMYL-THF] == * smiles: ** C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))[CH]...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=5FTHFtm 5FTHFtm] == * direction: ** REVERSIBLE * common name: ** 5-Formyltetrahydrofolate uptake ca...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-FORMYL-THF 5-FORMYL-THF] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=5FTHFtm 5FTHFtm] ==
−
* smiles:
+
* direction:
−
** C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))[CH]3(CNC2(=C(C(=O)NC(N)=N2)N([CH]=O)3))
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=VVIAGPKUTFNRDU-STQMWFEESA-L
+
 
* common name:
 
* common name:
−
** (6S)-5-formyl-tetrahydrofolate mono-L-glutamate
+
** 5-Formyltetrahydrofolate uptake carrier, mitochondria
−
* molecular weight:
+
−
** 471.429   
+
 
* Synonym(s):
 
* Synonym(s):
−
** n5-formyltetrahydrofolate monoglutamate
 
−
** n5-formyl-thf monoglutamate
 
−
** N5-formyl-THF monoglutamate
 
−
** 5-formyl-H4F monoglutamate
 
−
** 5-formyl-THF monoglutamate
 
−
** folinic acid monoglutamate
 
−
** 5-CHO-THF monoglutamate
 
−
** folinate
 
−
** formyl-H4F monoglutamate
 
−
** citrovorum factor
 
−
** N5-formyl-H4F monoglutamate
 
−
** N5-formyl-H4PteGlu1
 
−
** (6S)-leucovorin
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1.0 [[PROTON]][c] '''+''' 1.0 [[5-FORMYL-THF]][c] '''<=>''' 1.0 [[5-FORMYL-THF]][m] '''+''' 1.0 [[PROTON]][m]
−
* [[5FTHFt]]
+
* With common name(s):
−
* [[5FTHFtm]]
+
** 1.0 H+[c] '''+''' 1.0 (6S)-5-formyl-tetrahydrofolate mono-L-glutamate[c] '''<=>''' 1.0 (6S)-5-formyl-tetrahydrofolate mono-L-glutamate[m] '''+''' 1.0 H+[m]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_19115]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[creinhardtii]]
 
== External links  ==
 
== External links  ==
−
* CAS : 58-05-9
+
{{#set: direction=REVERSIBLE}}
−
* PUBCHEM:
+
{{#set: common name=5-Formyltetrahydrofolate uptake carrier, mitochondria}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6560146 6560146]
+
{{#set: gene associated=Tiso_gene_19115}}
−
* HMDB : HMDB01562
+
{{#set: in pathway=}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03479 C03479]
+
{{#set: reconstruction tool=pantograph}}
−
* CHEMSPIDER:
+
{{#set: reconstruction source=creinhardtii}}
−
** [http://www.chemspider.com/Chemical-Structure.5028014.html 5028014]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57457 57457]
+
−
* METABOLIGHTS : MTBLC57457
+
−
{{#set: smiles=C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))[CH]3(CNC2(=C(C(=O)NC(N)=N2)N([CH]=O)3))}}
+
−
{{#set: inchi key=InChIKey=VVIAGPKUTFNRDU-STQMWFEESA-L}}
+
−
{{#set: common name=(6S)-5-formyl-tetrahydrofolate mono-L-glutamate}}
+
−
{{#set: molecular weight=471.429    }}
+
−
{{#set: common name=n5-formyltetrahydrofolate monoglutamate|n5-formyl-thf monoglutamate|N5-formyl-THF monoglutamate|5-formyl-H4F monoglutamate|5-formyl-THF monoglutamate|folinic acid monoglutamate|5-CHO-THF monoglutamate|folinate|formyl-H4F monoglutamate|citrovorum factor|N5-formyl-H4F monoglutamate|N5-formyl-H4PteGlu1|(6S)-leucovorin}}
+
−
{{#set: consumed or produced by=5FTHFt|5FTHFtm}}
+

Revision as of 17:35, 10 January 2018

Reaction 5FTHFtm

  • direction:
    • REVERSIBLE
  • common name:
    • 5-Formyltetrahydrofolate uptake carrier, mitochondria
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 H+[c] + 1.0 (6S)-5-formyl-tetrahydrofolate mono-L-glutamate[c] <=> 1.0 (6S)-5-formyl-tetrahydrofolate mono-L-glutamate[m] + 1.0 H+[m]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Cis-delta13-3-hydroxylacceroyl-ACPs&oldid=13627"