Difference between revisions of "CYCLOEUCALENOL-CYCLOISOMERASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINOL HISTIDINOL] == * smiles: ** C1(NC=NC=1CC(CO)[N+]) * inchi key: ** InChIKey=ZQISRDCJN...")
 
(Created page with "Category:Gene == Gene Tiso_gene_9644 == * left end position: ** 2645 * transcription direction: ** POSITIVE * right end position: ** 7517 * centisome position: ** 28.88500...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINOL HISTIDINOL] ==
+
== Gene Tiso_gene_9644 ==
−
* smiles:
+
* left end position:
−
** C1(NC=NC=1CC(CO)[N+])
+
** 2645
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ZQISRDCJNBUVMM-YFKPBYRVSA-O
+
** POSITIVE
−
* common name:
+
* right end position:
−
** histidinol
+
** 7517
−
* molecular weight:
+
* centisome position:
−
** 142.18    
+
** 28.885006    
 
* Synonym(s):
 
* Synonym(s):
−
** histidol
 
−
** L-histidinol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-8001]]
+
* [[3.1.4.17-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
−
* [[HISTIDPHOS-RXN]]
+
***ec-number
−
== Reaction(s) of unknown directionality ==
+
** [[pantograph]]-[[esiliculosus]]
−
* [[HISTOLDEHYD-RXN]]
+
* [[35-CYCLIC-GMP-PHOSPHODIESTERASE-RXN]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
* [[APN]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
* [[RXN0-5038]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* CAS : 501-28-0
+
{{#set: left end position=2645}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6950298 6950298]
+
{{#set: right end position=7517}}
−
* KNAPSACK : C00007479
+
{{#set: centisome position=28.885006   }}
−
* HMDB : HMDB03431
+
{{#set: reaction associated=3.1.4.17-RXN|35-CYCLIC-GMP-PHOSPHODIESTERASE-RXN|APN|RXN0-5038}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00860 C00860]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57699 57699]
+
−
* BIGG : histd
+
−
{{#set: smiles=C1(NC=NC=1CC(CO)[N+])}}
+
−
{{#set: inchi key=InChIKey=ZQISRDCJNBUVMM-YFKPBYRVSA-O}}
+
−
{{#set: common name=histidinol}}
+
−
{{#set: molecular weight=142.18   }}
+
−
{{#set: common name=histidol|L-histidinol}}
+
−
{{#set: consumed by=RXN-8001}}
+
−
{{#set: produced by=HISTIDPHOS-RXN}}
+
−
{{#set: consumed or produced by=HISTOLDEHYD-RXN}}
+

Revision as of 17:35, 10 January 2018

Gene Tiso_gene_9644

  • left end position:
    • 2645
  • transcription direction:
    • POSITIVE
  • right end position:
    • 7517
  • centisome position:
    • 28.885006
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CYCLOEUCALENOL-CYCLOISOMERASE-RXN&oldid=13630"