Difference between revisions of "COBALSYN-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1103 CPD-1103] == * smiles: ** C1(C=C(O)C=CC=1C(OC2(OC(CO)C(O)C(O)C(O)2))C#N) * inchi key:...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=COBALSYN-PWY COBALSYN-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-122...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=COBALSYN-PWY COBALSYN-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** adenosylcobalamin salvage from cobinamide I |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** vitamin B12 biosynthesis |
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | * '''2''' reaction(s) found |
− | == Reaction(s) | + | ** [[BTUR2-RXN]] |
− | + | ** [[RXN-8770]] | |
+ | == Reaction(s) not found == | ||
+ | * '''4''' reaction(s) not found | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=COBINPGUANYLYLTRANS-RXN COBINPGUANYLYLTRANS-RXN] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=COBINAMIDEKIN-RXN COBINAMIDEKIN-RXN] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=COBALAMIN5PSYN-RXN COBALAMIN5PSYN-RXN] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=DMBPPRIBOSYLTRANS-RXN DMBPPRIBOSYLTRANS-RXN] | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=COBALSYN-PWY COBALSYN-PWY] | |
− | ** [http:// | + | {{#set: taxonomic range=TAX-1224}} |
− | + | {{#set: common name=adenosylcobalamin salvage from cobinamide I}} | |
− | + | {{#set: common name=vitamin B12 biosynthesis}} | |
− | + | {{#set: reaction found=2}} | |
− | + | {{#set: reaction not found=4}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 16:35, 10 January 2018
Pathway COBALSYN-PWY
- taxonomic range:
- common name:
- adenosylcobalamin salvage from cobinamide I
- Synonym(s):
- vitamin B12 biosynthesis
Reaction(s) found
Reaction(s) not found
- 4 reaction(s) not found
External links
- ECOCYC: