Difference between revisions of "ARG-PRO-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12601 CPD-12601] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O)O1) * inchi key: ** InChIKey=WQZGKK...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14973 RXN-14973] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14973 RXN-14973] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | == | + | * With identifiers: |
| − | * [[ | + | ** 2 [[NADPH]][c] '''+''' 1 [[3-Oxo-octanoyl-ACPs]][c] '''+''' 2 [[PROTON]][c] '''=>''' 1 [[Octanoyl-ACPs]][c] '''+''' 1 [[WATER]][c] '''+''' 2 [[NADP]][c] |
| − | + | * With common name(s): | |
| − | == | + | ** 2 NADPH[c] '''+''' 1 a 3-oxo-octanoyl-[acp][c] '''+''' 2 H+[c] '''=>''' 1 an octanoyl-[acp][c] '''+''' 1 H2O[c] '''+''' 2 NADP+[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | == Pathways == | ||
| + | * [[PWY-7388]], octanoyl-[acyl-carrier protein] biosynthesis (mitochondria, yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7388 PWY-7388] | ||
| + | ** '''9''' reactions found over '''9''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * [[annotation]]: | ||
| + | ** [[pathwaytools]]: | ||
| + | *** [[experimental_annotation]] | ||
| + | *** [[in-silico_annotation]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: in pathway=PWY-7388}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | {{#set: reconstruction source=experimental_annotation|in-silico_annotation}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 16:36, 10 January 2018
Contents
Reaction RXN-14973
- direction:
- LEFT-TO-RIGHT
- Synonym(s):
Reaction Formula
- With identifiers:
- 2 NADPH[c] + 1 3-Oxo-octanoyl-ACPs[c] + 2 PROTON[c] => 1 Octanoyl-ACPs[c] + 1 WATER[c] + 2 NADP[c]
- With common name(s):
- 2 NADPH[c] + 1 a 3-oxo-octanoyl-[acp][c] + 2 H+[c] => 1 an octanoyl-[acp][c] + 1 H2O[c] + 2 NADP+[c]
Genes associated with this reaction
Pathways
- PWY-7388, octanoyl-[acyl-carrier protein] biosynthesis (mitochondria, yeast): PWY-7388
- 9 reactions found over 9 reactions in the full pathway
