Difference between revisions of "Tiso gene 16450"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1466 PWY0-1466] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-27 CPDQT-27] == * smiles: ** CSCCCCC(=O)C([O-])=O * inchi key: ** InChIKey=GRUGZHAOXOPASC...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1466 PWY0-1466] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-27 CPDQT-27] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
+
** CSCCCCC(=O)C([O-])=O
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
* inchi key:
 +
** InChIKey=GRUGZHAOXOPASC-UHFFFAOYSA-M
 
* common name:
 
* common name:
−
** trehalose degradation VI (periplasmic)
+
** 6-(methylthio)-2-oxohexanoate
 +
* molecular weight:
 +
** 175.222   
 
* Synonym(s):
 
* Synonym(s):
 +
** 6-(methylthio)-2-oxohexanoic acid
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
* '''2''' reaction(s) found
+
== Reaction(s) known to produce the compound ==
−
** [[TREHALA-RXN]]
+
* [[RXN-18209]]
−
** [[ALDOSE-1-EPIMERASE-RXN]]
+
* [[RXNQT-4165]]
−
== Reaction(s) not found ==
+
== Reaction(s) of unknown directionality ==
−
* '''0''' reaction(s) not found
+
 
== External links  ==
 
== External links  ==
−
* ECOCYC:
+
* PUBCHEM:
−
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY0-1466 PWY0-1466]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237195 44237195]
−
{{#set: taxonomic range=TAX-4751}}
+
* KNAPSACK : C00007648
−
{{#set: taxonomic range=TAX-2}}
+
{{#set: smiles=CSCCCCC(=O)C([O-])=O}}
−
{{#set: common name=trehalose degradation VI (periplasmic)}}
+
{{#set: inchi key=InChIKey=GRUGZHAOXOPASC-UHFFFAOYSA-M}}
−
{{#set: reaction found=2}}
+
{{#set: common name=6-(methylthio)-2-oxohexanoate}}
−
{{#set: reaction not found=0}}
+
{{#set: molecular weight=175.222    }}
 +
{{#set: common name=6-(methylthio)-2-oxohexanoic acid}}
 +
{{#set: produced by=RXN-18209|RXNQT-4165}}

Revision as of 16:37, 10 January 2018

Metabolite CPDQT-27

  • smiles:
    • CSCCCCC(=O)C([O-])=O
  • inchi key:
    • InChIKey=GRUGZHAOXOPASC-UHFFFAOYSA-M
  • common name:
    • 6-(methylthio)-2-oxohexanoate
  • molecular weight:
    • 175.222
  • Synonym(s):
    • 6-(methylthio)-2-oxohexanoic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • PUBCHEM:
  • KNAPSACK : C00007648
"CSCCCCC(=O)C([O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_16450&oldid=13821"