Difference between revisions of "2.4.1.142-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11674 CPD-11674] == * smiles: ** C(O)CC1(=CNC2(=C1C=C(OS(=O)(=O)[O-])C=C2)) * inchi key: **...")
 
(Created page with "Category:Gene == Gene Tiso_gene_17657 == * left end position: ** 127 * transcription direction: ** NEGATIVE * right end position: ** 3486 * centisome position: ** 3.581500...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11674 CPD-11674] ==
+
== Gene Tiso_gene_17657 ==
−
* smiles:
+
* left end position:
−
** C(O)CC1(=CNC2(=C1C=C(OS(=O)(=O)[O-])C=C2))
+
** 127
−
* inchi key:
+
* transcription direction:
−
** InChIKey=FOCUAJYUOXSNDS-UHFFFAOYSA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 5-hydroxytryptophol sulfate
+
** 3486
−
* molecular weight:
+
* centisome position:
−
** 256.253    
+
** 3.5815005    
 
* Synonym(s):
 
* Synonym(s):
−
** 5-hydroxytryptophol sulphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[CYSTEINE--TRNA-LIGASE-RXN]]
−
* [[RXN-10782]]
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
** experimental_annotation
 +
***ec-number
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways associated ==
 +
* [[TRNA-CHARGING-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=127}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237265 44237265]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=C(O)CC1(=CNC2(=C1C=C(OS(=O)(=O)[O-])C=C2))}}
+
{{#set: right end position=3486}}
−
{{#set: inchi key=InChIKey=FOCUAJYUOXSNDS-UHFFFAOYSA-M}}
+
{{#set: centisome position=3.5815005   }}
−
{{#set: common name=5-hydroxytryptophol sulfate}}
+
{{#set: reaction associated=CYSTEINE--TRNA-LIGASE-RXN}}
−
{{#set: molecular weight=256.253   }}
+
{{#set: pathway associated=TRNA-CHARGING-PWY}}
−
{{#set: common name=5-hydroxytryptophol sulphate}}
+
−
{{#set: produced by=RXN-10782}}
+

Revision as of 16:38, 10 January 2018

Gene Tiso_gene_17657

  • left end position:
    • 127
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 3486
  • centisome position:
    • 3.5815005
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=2.4.1.142-RXN&oldid=13906"