Difference between revisions of "Palmitoyl-proteins"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-289 CPD-289] == * smiles: ** C1(=CC(C(C=C1)O)O) * inchi key: ** InChIKey=YDRSQRPHLBEPTP-PHD...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16017 RXN-16017] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-289 CPD-289] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16017 RXN-16017] ==
* smiles:
+
* direction:
** C1(=CC(C(C=C1)O)O)
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=YDRSQRPHLBEPTP-PHDIDXHHSA-N
+
** [http://enzyme.expasy.org/EC/2.3.1 EC-2.3.1]
* common name:
+
** (1R,2R)-cyclohexa-3,5-diene-1,2-diol
+
* molecular weight:
+
** 112.128   
+
 
* Synonym(s):
 
* Synonym(s):
** trans-1,2-dihydrobenzene-1,2-diol
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
== Reaction(s) of unknown directionality ==
+
** 1 [[ACETYL-COA]][c] '''+''' 10 [[MALONYL-COA]][c] '''+''' 23 [[PROTON]][c] '''+''' 14 [[NADPH]][c] '''=>''' 9 [[WATER]][c] '''+''' 14 [[NADP]][c] '''+''' 11 [[CO-A]][c] '''+''' 10 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CPD-10244]][c]
* [[1.3.1.20-RXN]]
+
* With common name(s):
 +
** 1 acetyl-CoA[c] '''+''' 10 malonyl-CoA[c] '''+''' 23 H+[c] '''+''' 14 NADPH[c] '''=>''' 9 H2O[c] '''+''' 14 NADP+[c] '''+''' 11 coenzyme A[c] '''+''' 10 CO2[c] '''+''' 1 docosahexaenoate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-7585]], docosahexaenoate biosynthesis II (bacteria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7585 PWY-7585]
 +
** '''1''' reactions found over '''1''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[gap-filling]]:
 +
** [[meneco]]:
 +
*** [[added for gapfilling]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=149186 149186]
+
{{#set: ec number=EC-2.3.1}}
* CHEMSPIDER:
+
{{#set: in pathway=PWY-7585}}
** [http://www.chemspider.com/Chemical-Structure.131491.html 131491]
+
{{#set: reconstruction category=gap-filling}}
* CHEBI:
+
{{#set: reconstruction tool=meneco}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=10702 10702]
+
{{#set: reconstruction source=added for gapfilling}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C04221 C04221]
+
* HMDB : HMDB01164
+
{{#set: smiles=C1(=CC(C(C=C1)O)O)}}
+
{{#set: inchi key=InChIKey=YDRSQRPHLBEPTP-PHDIDXHHSA-N}}
+
{{#set: common name=(1R,2R)-cyclohexa-3,5-diene-1,2-diol}}
+
{{#set: molecular weight=112.128    }}
+
{{#set: common name=trans-1,2-dihydrobenzene-1,2-diol}}
+
{{#set: consumed or produced by=1.3.1.20-RXN}}
+

Revision as of 16:38, 10 January 2018

Reaction RXN-16017

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Pathways

  • PWY-7585, docosahexaenoate biosynthesis II (bacteria): PWY-7585
    • 1 reactions found over 1 reactions in the full pathway

Reconstruction information

External links