Difference between revisions of "CPD-289"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9758 CPD-9758] == * smiles: ** CC(=CCCC(=CCOC(C)=O)C)C * inchi key: ** InChIKey=HIGQPQRQIQD...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-cis-D17-35-3-hydroxyC54-2-ACPs cis-cis-D17-35-3-hydroxyC54-2-ACPs] == * common name: ** a c...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9758 CPD-9758] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-cis-D17-35-3-hydroxyC54-2-ACPs cis-cis-D17-35-3-hydroxyC54-2-ACPs] ==
* smiles:
+
** CC(=CCCC(=CCOC(C)=O)C)C
+
* inchi key:
+
** InChIKey=HIGQPQRQIQDZMP-DHZHZOJOSA-N
+
 
* common name:
 
* common name:
** geranyl acetate
+
** a cis,cis-delta17,35-3-hydroxyC54:2-[acp]
* molecular weight:
+
** 196.289   
+
 
* Synonym(s):
 
* Synonym(s):
** geraniol acetate
+
** a cis,cis-delta 17,35-3-hydroxy-C54:2-[acyl-carrier-protein]
** neryl acetate
+
** geranyl acetate, cis-
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN1G-220]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9192]]
+
* [[RXN1G-184]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a cis,cis-delta17,35-3-hydroxyC54:2-[acp]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1549026 1549026]
+
{{#set: common name=a cis,cis-delta 17,35-3-hydroxy-C54:2-[acyl-carrier-protein]}}
* CHEMSPIDER:
+
{{#set: consumed by=RXN1G-220}}
** [http://www.chemspider.com/Chemical-Structure.1266019.html 1266019]
+
{{#set: produced by=RXN1G-184}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=5331 5331]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C09861 C09861]
+
* HMDB : HMDB35157
+
{{#set: smiles=CC(=CCCC(=CCOC(C)=O)C)C}}
+
{{#set: inchi key=InChIKey=HIGQPQRQIQDZMP-DHZHZOJOSA-N}}
+
{{#set: common name=geranyl acetate}}
+
{{#set: molecular weight=196.289    }}
+
{{#set: common name=geraniol acetate|neryl acetate|geranyl acetate, cis-}}
+
{{#set: produced by=RXN-9192}}
+

Revision as of 17:39, 10 January 2018

Metabolite cis-cis-D17-35-3-hydroxyC54-2-ACPs

  • common name:
    • a cis,cis-delta17,35-3-hydroxyC54:2-[acp]
  • Synonym(s):
    • a cis,cis-delta 17,35-3-hydroxy-C54:2-[acyl-carrier-protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a cis,cis-delta17,35-3-hydroxyC54:2-[acp" cannot be used as a page name in this wiki.
"a cis,cis-delta 17,35-3-hydroxy-C54:2-[acyl-carrier-protein" cannot be used as a page name in this wiki.