Difference between revisions of "Cis-cis-D19-31-3-hydroxyC50-2-ACPs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE SHIKIMATE] == * smiles: ** C1(=C(CC(C(O)C(O)1)O)C(=O)[O-]) * inchi key: ** InChIKey=J...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWYQT-4476 PWYQT-4476] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3699 TA...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWYQT-4476 PWYQT-4476] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3699 TAX-3699] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** indole glucosinolate activation (herbivore attack) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** indole glucosinolate breakdown (herbivore attack) |
− | ** | + | ** glucosinolate degradation |
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | * '''1''' reaction(s) found |
− | == Reaction(s) | + | ** [[RXN-1404]] |
− | * [[ | + | == Reaction(s) not found == |
− | == | + | * '''12''' reaction(s) not found |
− | * [[ | + | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-12206 RXN-12206] |
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-12205 RXN-12205] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-18230 RXN-18230] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-1444 RXN-1444] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXNQT-4356 RXNQT-4356] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXNQT-4357 RXNQT-4357] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXNQT-4355 RXNQT-4355] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXNQT-4352 RXNQT-4352] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXNQT-4353 RXNQT-4353] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXNQT-4350 RXNQT-4350] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXNQT-4351 RXNQT-4351] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXNQT-4358 RXNQT-4358] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-3699}} | |
− | + | {{#set: common name=indole glucosinolate activation (herbivore attack)}} | |
− | + | {{#set: common name=indole glucosinolate breakdown (herbivore attack)|glucosinolate degradation}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: reaction not found=12}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 17:40, 10 January 2018
Pathway PWYQT-4476
- taxonomic range:
- common name:
- indole glucosinolate activation (herbivore attack)
- Synonym(s):
- indole glucosinolate breakdown (herbivore attack)
- glucosinolate degradation
Reaction(s) found
- 1 reaction(s) found
Reaction(s) not found
- 12 reaction(s) not found