Difference between revisions of "Negatively-super-coiled-DNAs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-Acylated-Aliphatic-Amino-Acids N-Acylated-Aliphatic-Amino-Acids] == * common name: ** an N-ac...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-38 CPDQT-38] == * smiles: ** CSCCCCCC(C(O)C(=O)[O-])C(=O)[O-] * inchi key: ** InChIKey=YB...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-Acylated-Aliphatic-Amino-Acids N-Acylated-Aliphatic-Amino-Acids] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-38 CPDQT-38] ==
 +
* smiles:
 +
** CSCCCCCC(C(O)C(=O)[O-])C(=O)[O-]
 +
* inchi key:
 +
** InChIKey=YBISUHXEJDGADQ-UHFFFAOYSA-L
 
* common name:
 
* common name:
** an N-acylated aliphatic-L-amino acid
+
** 3-(5'-methylthio)pentylmalate
 +
* molecular weight:
 +
** 248.293   
 
* Synonym(s):
 
* Synonym(s):
** an N-acyl-aliphatic-L-amino acid
+
** 3-(5'-methylthio)pentylmalic acid
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXNQT-4171]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[AMINOACYLASE-RXN]]
+
* [[RXN-18204]]
 
== External links  ==
 
== External links  ==
{{#set: common name=an N-acylated aliphatic-L-amino acid}}
+
* PUBCHEM:
{{#set: common name=an N-acyl-aliphatic-L-amino acid}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237178 44237178]
{{#set: consumed or produced by=AMINOACYLASE-RXN}}
+
{{#set: smiles=CSCCCCCC(C(O)C(=O)[O-])C(=O)[O-]}}
 +
{{#set: inchi key=InChIKey=YBISUHXEJDGADQ-UHFFFAOYSA-L}}
 +
{{#set: common name=3-(5'-methylthio)pentylmalate}}
 +
{{#set: molecular weight=248.293    }}
 +
{{#set: common name=3-(5'-methylthio)pentylmalic acid}}
 +
{{#set: consumed by=RXNQT-4171}}
 +
{{#set: consumed or produced by=RXN-18204}}

Revision as of 16:40, 10 January 2018

Metabolite CPDQT-38

  • smiles:
    • CSCCCCCC(C(O)C(=O)[O-])C(=O)[O-]
  • inchi key:
    • InChIKey=YBISUHXEJDGADQ-UHFFFAOYSA-L
  • common name:
    • 3-(5'-methylthio)pentylmalate
  • molecular weight:
    • 248.293
  • Synonym(s):
    • 3-(5'-methylthio)pentylmalic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CSCCCCCC(C(O)C(=O)[O-])C(=O)[O-" cannot be used as a page name in this wiki.