Difference between revisions of "Tiso gene 3577"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DIPHTINE--AMMONIA-LIGASE-RXN DIPHTINE--AMMONIA-LIGASE-RXN] == * direction: ** LEFT-TO-RIGHT * commo...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7280 CPD-7280] == * smiles: ** CC(C=CC=C(C)C=CC12(OC(CC(O)CC(C)(C)1)2))=CC=CC=C(C)CC=O * in...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DIPHTINE--AMMONIA-LIGASE-RXN DIPHTINE--AMMONIA-LIGASE-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7280 CPD-7280] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C=CC=C(C)C=CC12(OC(CC(O)CC(C)(C)1)2))=CC=CC=C(C)CC=O
 +
* inchi key:
 +
** InChIKey=FYYDCJDEFSYVOY-WENURHBKSA-N
 
* common name:
 
* common name:
−
** endoribonuclease_l-psp_domain-containing_protein
+
** (3S,5R,6S)-5,6-epoxy-3-hydroxy-5,6-dihydro-12'-apo-β-caroten-12'-al
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/6.3.1.14 EC-6.3.1.14]
+
** 382.542   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[AMMONIUM]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[DIPHTINE]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[DIPHTHAMIDE]][c] '''+''' 1 [[AMP]][c] '''+''' 1 [[PPI]][c]
+
* [[RXN-7974]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 ammonium[c] '''+''' 1 ATP[c] '''+''' 1 a diphthine-[translation elongation factor 2][c] '''=>''' 1 H+[c] '''+''' 1 a diphthamide-[translation elongation factor 2][c] '''+''' 1 AMP[c] '''+''' 1 diphosphate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_3764]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-6482]], diphthamide biosynthesis (archaea): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6482 PWY-6482]
+
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY-7546]], diphthamide biosynthesis (eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7546 PWY-7546]
+
−
** '''1''' reactions found over '''4''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=19753 19753]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246021 25246021]
−
* LIGAND-RXN:
+
{{#set: smiles=CC(C=CC=C(C)C=CC12(OC(CC(O)CC(C)(C)1)2))=CC=CC=C(C)CC=O}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R03613 R03613]
+
{{#set: inchi key=InChIKey=FYYDCJDEFSYVOY-WENURHBKSA-N}}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: common name=(3S,5R,6S)-5,6-epoxy-3-hydroxy-5,6-dihydro-12'-apo-β-caroten-12'-al}}
−
{{#set: common name=endoribonuclease_l-psp_domain-containing_protein}}
+
{{#set: molecular weight=382.542    }}
−
{{#set: ec number=EC-6.3.1.14}}
+
{{#set: produced by=RXN-7974}}
−
{{#set: gene associated=Tiso_gene_3764}}
+
−
{{#set: in pathway=PWY-6482|PWY-7546}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=in-silico_annotation}}
+

Revision as of 16:41, 10 January 2018

Metabolite CPD-7280

  • smiles:
    • CC(C=CC=C(C)C=CC12(OC(CC(O)CC(C)(C)1)2))=CC=CC=C(C)CC=O
  • inchi key:
    • InChIKey=FYYDCJDEFSYVOY-WENURHBKSA-N
  • common name:
    • (3S,5R,6S)-5,6-epoxy-3-hydroxy-5,6-dihydro-12'-apo-β-caroten-12'-al
  • molecular weight:
    • 382.542
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_3577&oldid=14110"