Difference between revisions of "Tiso gene 14226"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10277 CPD-10277] == * smiles: ** CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C * inchi key: ** InChIK...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY4FS-12 PWY4FS-12] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10277 CPD-10277] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY4FS-12 PWY4FS-12] ==
−
* smiles:
+
* taxonomic range:
−
** CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
−
* inchi key:
+
−
** InChIKey=WEWBWVMTOYUPHH-QHAQEBJBSA-N
+
 
* common name:
 
* common name:
−
** lotaustralin
+
** VTC2 cycle
−
* molecular weight:
+
−
** 261.274   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2-hydroxy-2-methylbutyronitrile-beta-D-glucopyranoside
+
** GDP-D-mannose biosynthesis
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-9674]]
+
* '''1''' reaction(s) found
−
== Reaction(s) known to produce the compound ==
+
** [[RXN-1882]]
−
* [[RXN-13603]]
+
== Reaction(s) not found ==
−
== Reaction(s) of unknown directionality ==
+
* '''1''' reaction(s) not found
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN4FS-12 RXN4FS-12]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-33090}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=441467 441467]
+
{{#set: common name=VTC2 cycle}}
−
* CHEBI:
+
{{#set: common name=GDP-D-mannose biosynthesis}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=6542 6542]
+
{{#set: reaction found=1}}
−
* LIGAND-CPD:
+
{{#set: reaction not found=1}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C08334 C08334]
+
−
* HMDB : HMDB33865
+
−
{{#set: smiles=CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C}}
+
−
{{#set: inchi key=InChIKey=WEWBWVMTOYUPHH-QHAQEBJBSA-N}}
+
−
{{#set: common name=lotaustralin}}
+
−
{{#set: molecular weight=261.274    }}
+
−
{{#set: common name=2-hydroxy-2-methylbutyronitrile-beta-D-glucopyranoside}}
+
−
{{#set: consumed by=RXN-9674}}
+
−
{{#set: produced by=RXN-13603}}
+

Revision as of 17:41, 10 January 2018

Pathway PWY4FS-12

  • taxonomic range:
  • common name:
    • VTC2 cycle
  • Synonym(s):
    • GDP-D-mannose biosynthesis

Reaction(s) found

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_14226&oldid=14147"