Difference between revisions of "Tiso gene 9472"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11398 CPD-11398] == * smiles: ** C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=C(I)C(OC2(OC(...")
 
(Created page with "Category:Gene == Gene Tiso_gene_8328 == * left end position: ** 585 * transcription direction: ** POSITIVE * right end position: ** 2849 * centisome position: ** 5.6581874...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11398 CPD-11398] ==
+
== Gene Tiso_gene_8328 ==
* smiles:
+
* left end position:
** C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=C(I)C(OC2(OC(C(=O)[O-])C(O)C(O)C(O)2))=C(I)C=3))
+
** 585
* inchi key:
+
* transcription direction:
** InChIKey=RGHRJBIKIYUHEV-SGPDEFQSSA-M
+
** POSITIVE
* common name:
+
* right end position:
** L-thyroxine phenolic β-D-glucuronide
+
** 2849
* molecular weight:
+
* centisome position:
** 951.992    
+
** 5.6581874    
 
* Synonym(s):
 
* Synonym(s):
** L-thyroxine phenolic glucuronide
 
** thyroxine glucuronide
 
** beta-D-glucopyranosiduronic acid, 4-(4-(2-amino-2-carboxyethyl)-2,6-diiodophenoxy)-2,6-diiodophenyl, (S)-
 
** T4G
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* [[PROTEIN-KINASE-RXN]]
* [[RXN-10606]]
+
** in-silico_annotation
== Reaction(s) of unknown directionality ==
+
***automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=585}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237176 44237176]
+
{{#set: transcription direction=POSITIVE}}
{{#set: smiles=C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=C(I)C(OC2(OC(C(=O)[O-])C(O)C(O)C(O)2))=C(I)C=3))}}
+
{{#set: right end position=2849}}
{{#set: inchi key=InChIKey=RGHRJBIKIYUHEV-SGPDEFQSSA-M}}
+
{{#set: centisome position=5.6581874   }}
{{#set: common name=L-thyroxine phenolic β-D-glucuronide}}
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
{{#set: molecular weight=951.992   }}
+
{{#set: common name=L-thyroxine phenolic glucuronide|thyroxine glucuronide|beta-D-glucopyranosiduronic acid, 4-(4-(2-amino-2-carboxyethyl)-2,6-diiodophenoxy)-2,6-diiodophenyl, (S)-|T4G}}
+
{{#set: produced by=RXN-10606}}
+

Revision as of 17:41, 10 January 2018

Gene Tiso_gene_8328

  • left end position:
    • 585
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2849
  • centisome position:
    • 5.6581874
  • Synonym(s):

Reactions associated

Pathways associated

External links